|
Name |
Dicerandrol A
|
| Molecular Formula | C34H34O14 | |
| IUPAC Name* |
[(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-1,9-dihydroxy-10a-(hydroxymethyl)-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-8,9-dihydroxy-4a-(hydroxymethyl)-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4-yl] acetate
|
|
| SMILES |
C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)O[C@@]6([C@@H]([C@@H](CC(=O)C6=C5O)C)OC(=O)C)CO)O)O[C@@]2([C@@H]1OC(=O)C)CO)O
|
|
| InChI |
InChI=1S/C34H34O14/c1-13-9-19(39)25-29(43)23-21(47-33(25,11-35)31(13)45-15(3)37)7-5-17(27(23)41)18-6-8-22-24(28(18)42)30(44)26-20(40)10-14(2)32(46-16(4)38)34(26,12-36)48-22/h5-8,13-14,31-32,35-36,41-44H,9-12H2,1-4H3/t13-,14-,31-,32-,33+,34+/m1/s1
|
|
| InChIKey |
KMPJMYCHERZRLM-FNCICBJWSA-N
|
|
| Synonyms |
Dicerandrol A; CHEBI:65764; (5R,5'R,6R,6'R,10aR,10a'R)-1,1',8,8'-tetrahydroxy-10a,10a'-bis(hydroxymethyl)-6,6'-dimethyl-9,9'-dioxo-5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,2'-bixanthene-5,5'-diyldiacetate; CHEMBL460126; Q27134250; [(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-1,9-dihydroxy-10a-(hydroxymethyl)-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-8,9-dihydroxy-4a-(hydroxymethyl)-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4-yl] acetate
|
|
| CAS | NA | |
| PubChem CID | 10258888 | |
| ChEMBL ID | CHEMBL460126 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 666.6 | ALogp: | 1.6 |
| HBD: | 6 | HBA: | 14 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 227.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 48 | QED Weighted: | 0.252 |
| Caco-2 Permeability: | -5.935 | MDCK Permeability: | 0.00000997 |
| Pgp-inhibitor: | 0.39 | Pgp-substrate: | 0.985 |
| Human Intestinal Absorption (HIA): | 0.872 | 20% Bioavailability (F20%): | 0.787 |
| 30% Bioavailability (F30%): | 0.856 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 85.86% |
| Volume Distribution (VD): | 0.605 | Fu: | 9.42% |
| CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.052 |
| CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.064 |
| CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.205 |
| CYP2D6-inhibitor: | 0.104 | CYP2D6-substrate: | 0.114 |
| CYP3A4-inhibitor: | 0.67 | CYP3A4-substrate: | 0.3 |
| Clearance (CL): | 2.192 | Half-life (T1/2): | 0.172 |
| hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.994 |
| Drug-inuced Liver Injury (DILI): | 0.979 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.971 | Maximum Recommended Daily Dose: | 0.041 |
| Skin Sensitization: | 0.045 | Carcinogencity: | 0.017 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.04 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001973 | ![]() |
0.874 | D0T5XN | ![]() |
0.279 | ||
| ENC002870 | ![]() |
0.775 | D07VLY | ![]() |
0.269 | ||
| ENC002105 | ![]() |
0.769 | D0C9XJ | ![]() |
0.269 | ||
| ENC002978 | ![]() |
0.686 | D01XDL | ![]() |
0.267 | ||
| ENC001969 | ![]() |
0.683 | D01XWG | ![]() |
0.266 | ||
| ENC005070 | ![]() |
0.680 | D0FX2Q | ![]() |
0.258 | ||
| ENC003646 | ![]() |
0.631 | D0Q0PR | ![]() |
0.251 | ||
| ENC000983 | ![]() |
0.628 | D07IPB | ![]() |
0.247 | ||
| ENC000710 | ![]() |
0.628 | D0G3DL | ![]() |
0.246 | ||
| ENC000954 | ![]() |
0.628 | D0T8EH | ![]() |
0.244 | ||