|
Name |
Phonmxanthone E
|
| Molecular Formula | C34H36O14 | |
| IUPAC Name* |
[7-[5-acetyloxy-1,8-dihydroxy-10a-(hydroxymethyl)-6-methyl-9-oxo-6,7-dihydro-5H-xanthen-2-yl]-1,4,8-trihydroxy-3-methyl-9-oxo-3,4,6,7-tetrahydro-2H-xanthen-4a-yl]methylacetate
|
|
| SMILES |
CC(=O)OCC12OC3=CCC(c4ccc5c(c4O)C(=O)C4=C(O)CC(C)C(OC(C)=O)C4(CO)O5)C(O)=C3C(=O)C1=C(O)CC(C)C2O
|
|
| InChI |
InChI=1S/C34H36O14/c1-13-9-19(38)26-30(43)24-22(48-34(26,31(13)44)12-45-15(3)36)8-6-18(28(24)41)17-5-7-21-23(27(17)40)29(42)25-20(39)10-14(2)32(46-16(4)37)33(25,11-35)47-21/h5,7-8,13-14,18,31-32,35,38-41,44H,6,9-12H2,1-4H3/t13-,14-,18?,31-,32-,33+,34+/m0/s1
|
|
| InChIKey |
WMUHZQFVKQWPQR-FCGGQDMGSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 668.65 | ALogp: | 2.8 |
| HBD: | 6 | HBA: | 14 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 226.6 | Aromatic Rings: | 6 |
| Heavy Atoms: | 48 | QED Weighted: | 0.247 |
| Caco-2 Permeability: | -5.386 | MDCK Permeability: | 0.00003370 |
| Pgp-inhibitor: | 0.921 | Pgp-substrate: | 0.996 |
| Human Intestinal Absorption (HIA): | 0.905 | 20% Bioavailability (F20%): | 0.91 |
| 30% Bioavailability (F30%): | 0.946 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 82.83% |
| Volume Distribution (VD): | 0.297 | Fu: | 14.90% |
| CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.073 |
| CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.124 |
| CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.091 |
| CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.079 |
| CYP3A4-inhibitor: | 0.792 | CYP3A4-substrate: | 0.304 |
| Clearance (CL): | 1.259 | Half-life (T1/2): | 0.071 |
| hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.922 |
| Drug-inuced Liver Injury (DILI): | 0.953 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.999 | Maximum Recommended Daily Dose: | 0.749 |
| Skin Sensitization: | 0.028 | Carcinogencity: | 0.022 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.003 |
| Respiratory Toxicity: | 0.129 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005070 | ![]() |
0.626 | D0T5XN | ![]() |
0.291 | ||
| ENC005074 | ![]() |
0.576 | D0C9XJ | ![]() |
0.283 | ||
| ENC004764 | ![]() |
0.559 | D07VLY | ![]() |
0.283 | ||
| ENC002870 | ![]() |
0.523 | D01XWG | ![]() |
0.280 | ||
| ENC001973 | ![]() |
0.523 | D01XDL | ![]() |
0.267 | ||
| ENC005073 | ![]() |
0.518 | D07IPB | ![]() |
0.264 | ||
| ENC001991 | ![]() |
0.512 | D0FX2Q | ![]() |
0.258 | ||
| ENC003646 | ![]() |
0.509 | D0G3DL | ![]() |
0.251 | ||
| ENC005075 | ![]() |
0.508 | D0T8EH | ![]() |
0.250 | ||
| ENC002978 | ![]() |
0.481 | D05CHI | ![]() |
0.245 | ||