|
Name |
12′-hydroxyroridin
|
| Molecular Formula | C29H38O9 | |
| IUPAC Name* |
17-(1-hydroxyethyl)-13-(hydroxymethyl)-5,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,22-dione
|
|
| SMILES |
CC1=CC2OC3CC4OC(=O)C=CC=CC(C(C)O)OCCC(CO)=CC(=O)OCC2(CC1)C4(C)C31CO1
|
|
| InChI |
InChI=1S/C29H38O9/c1-18-8-10-28-16-35-26(33)13-20(15-30)9-11-34-21(19(2)31)6-4-5-7-25(32)38-22-14-24(37-23(28)12-18)29(17-36-29)27(22,28)3/h4-7,12-13,19,21-24,30-31H,8-11,14-17H2,1-3H3/b6-4+,7-5-,20-13-/t19-,21-,22-,23-,24-,27-,28-,29+/m1/s1
|
|
| InChIKey |
FJAXVJONPZPBJY-KOFWCDLBSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 530.61 | ALogp: | 2.3 |
| HBD: | 2 | HBA: | 9 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 124.1 | Aromatic Rings: | 5 |
| Heavy Atoms: | 38 | QED Weighted: | 0.315 |
| Caco-2 Permeability: | -5.181 | MDCK Permeability: | 0.00001510 |
| Pgp-inhibitor: | 0.802 | Pgp-substrate: | 0.658 |
| Human Intestinal Absorption (HIA): | 0.217 | 20% Bioavailability (F20%): | 0.927 |
| 30% Bioavailability (F30%): | 0.97 |
| Blood-Brain-Barrier Penetration (BBB): | 0.973 | Plasma Protein Binding (PPB): | 52.13% |
| Volume Distribution (VD): | 1.639 | Fu: | 38.25% |
| CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.091 |
| CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.594 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.04 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.133 |
| CYP3A4-inhibitor: | 0.677 | CYP3A4-substrate: | 0.559 |
| Clearance (CL): | 8.204 | Half-life (T1/2): | 0.128 |
| hERG Blockers: | 0.326 | Human Hepatotoxicity (H-HT): | 0.119 |
| Drug-inuced Liver Injury (DILI): | 0.024 | AMES Toxicity: | 0.042 |
| Rat Oral Acute Toxicity: | 0.897 | Maximum Recommended Daily Dose: | 0.961 |
| Skin Sensitization: | 0.935 | Carcinogencity: | 0.312 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.768 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003126 | ![]() |
0.866 | D0I5DS | ![]() |
0.226 | ||
| ENC003943 | ![]() |
0.798 | D04QNO | ![]() |
0.223 | ||
| ENC003173 | ![]() |
0.744 | D0Y7IU | ![]() |
0.223 | ||
| ENC002240 | ![]() |
0.672 | D02JNM | ![]() |
0.221 | ||
| ENC002050 | ![]() |
0.648 | D0IX6I | ![]() |
0.221 | ||
| ENC004774 | ![]() |
0.622 | D0IL7L | ![]() |
0.221 | ||
| ENC002696 | ![]() |
0.605 | D0C7JF | ![]() |
0.217 | ||
| ENC003310 | ![]() |
0.595 | D04ATM | ![]() |
0.215 | ||
| ENC002026 | ![]() |
0.593 | D0K7HU | ![]() |
0.215 | ||
| ENC004446 | ![]() |
0.582 | D09WYX | ![]() |
0.213 | ||