|
Name |
(1S,3R,12E,17R,18E,20Z,24R,25S,26R)-17-[(1S)-1-hydroxyethyl]-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,22-dione
|
| Molecular Formula | C29H38O8 | |
| IUPAC Name* |
(1S,3R,12E,17R,18E,20Z,24R,25S,26R)-17-[(1S)-1-hydroxyethyl]-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,22-dione
|
|
| SMILES |
CC1=C[C@@H]2C3(CC1)COC(=O)/C=C(/CCO[C@H](/C=C/C=C\C(=O)O[C@H]4[C@]3([C@@]5(CO5)[C@H](C4)O2)C)[C@H](C)O)\C
|
|
| InChI |
InChI=1S/C29H38O8/c1-18-9-11-28-16-34-26(32)14-19(2)10-12-33-21(20(3)30)7-5-6-8-25(31)37-22-15-24(36-23(28)13-18)29(17-35-29)27(22,28)4/h5-8,13-14,20-24,30H,9-12,15-17H2,1-4H3/b7-5+,8-6-,19-14+/t20-,21+,22+,23+,24-,27+,28?,29+/m0/s1
|
|
| InChIKey |
KEEQQEKLEZRLDS-SKXHVDTQSA-N
|
|
| Synonyms |
Epiroridin E
|
|
| CAS | NA | |
| PubChem CID | 100950306 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 514.6 | ALogp: | 2.4 |
| HBD: | 1 | HBA: | 8 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 104.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 37 | QED Weighted: | 0.317 |
| Caco-2 Permeability: | -5.194 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.985 | Pgp-substrate: | 0.938 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.924 |
| 30% Bioavailability (F30%): | 0.746 |
| Blood-Brain-Barrier Penetration (BBB): | 0.381 | Plasma Protein Binding (PPB): | 82.26% |
| Volume Distribution (VD): | 2.025 | Fu: | 7.93% |
| CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.122 |
| CYP2C19-inhibitor: | 0.614 | CYP2C19-substrate: | 0.634 |
| CYP2C9-inhibitor: | 0.847 | CYP2C9-substrate: | 0.024 |
| CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.089 |
| CYP3A4-inhibitor: | 0.829 | CYP3A4-substrate: | 0.556 |
| Clearance (CL): | 1.652 | Half-life (T1/2): | 0.616 |
| hERG Blockers: | 0.667 | Human Hepatotoxicity (H-HT): | 0.788 |
| Drug-inuced Liver Injury (DILI): | 0.087 | AMES Toxicity: | 0.774 |
| Rat Oral Acute Toxicity: | 0.492 | Maximum Recommended Daily Dose: | 0.961 |
| Skin Sensitization: | 0.863 | Carcinogencity: | 0.12 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.909 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004775 | ![]() |
0.866 | D0C7JF | ![]() |
0.222 | ||
| ENC003943 | ![]() |
0.851 | D04GJN | ![]() |
0.221 | ||
| ENC002240 | ![]() |
0.763 | D04ATM | ![]() |
0.220 | ||
| ENC003173 | ![]() |
0.763 | D0K7HU | ![]() |
0.218 | ||
| ENC002050 | ![]() |
0.750 | D09WYX | ![]() |
0.217 | ||
| ENC003310 | ![]() |
0.661 | D0Z4ZT | ![]() |
0.216 | ||
| ENC004774 | ![]() |
0.637 | D0V4WD | ![]() |
0.215 | ||
| ENC002696 | ![]() |
0.619 | D06IIB | ![]() |
0.214 | ||
| ENC004446 | ![]() |
0.595 | D0Q4SD | ![]() |
0.214 | ||
| ENC002026 | ![]() |
0.570 | D0I2SD | ![]() |
0.213 | ||