|
Name |
14'-Hydroxymytoxin B
|
| Molecular Formula | C29H36O10 | |
| IUPAC Name* |
(1E,6R,11R,13R,14S,15S,16R,19Z,23S,27R)-27-hydroxy-23-(2-hydroxyacetyl)-9,15-dimethylspiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19-triene-14,2'-oxirane]-3,18-dione
|
|
| SMILES |
CC1=C[C@@H]2[C@@]3(CC1)COC(=O)/C=C/4\CCO[C@]([C@@H]4O)(CC/C=C\C(=O)O[C@H]5[C@]3([C@]6(CO6)[C@@H](C5)O2)C)C(=O)CO
|
|
| InChI |
InChI=1S/C29H36O10/c1-17-6-9-27-15-35-24(33)12-18-7-10-36-28(25(18)34,19(31)14-30)8-4-3-5-23(32)39-20-13-22(38-21(27)11-17)29(16-37-29)26(20,27)2/h3,5,11-12,20-22,25,30,34H,4,6-10,13-16H2,1-2H3/b5-3-,18-12+/t20-,21-,22-,25-,26-,27-,28-,29+/m1/s1
|
|
| InChIKey |
NXTLPIJHYLFGEX-VIVBWQMCSA-N
|
|
| Synonyms |
14'-Hydroxymytoxin B; CHEMBL4449215
|
|
| CAS | NA | |
| PubChem CID | 10437389 | |
| ChEMBL ID | CHEMBL4449215 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 544.6 | ALogp: | 0.7 |
| HBD: | 2 | HBA: | 10 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 39 | QED Weighted: | 0.301 |
| Caco-2 Permeability: | -5.402 | MDCK Permeability: | 0.00001400 |
| Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.988 |
| Human Intestinal Absorption (HIA): | 0.027 | 20% Bioavailability (F20%): | 0.989 |
| 30% Bioavailability (F30%): | 0.944 |
| Blood-Brain-Barrier Penetration (BBB): | 0.891 | Plasma Protein Binding (PPB): | 68.90% |
| Volume Distribution (VD): | 1.056 | Fu: | 18.14% |
| CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.625 |
| CYP2C19-inhibitor: | 0.116 | CYP2C19-substrate: | 0.556 |
| CYP2C9-inhibitor: | 0.05 | CYP2C9-substrate: | 0.017 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.034 |
| CYP3A4-inhibitor: | 0.806 | CYP3A4-substrate: | 0.883 |
| Clearance (CL): | 5.704 | Half-life (T1/2): | 0.838 |
| hERG Blockers: | 0.08 | Human Hepatotoxicity (H-HT): | 0.291 |
| Drug-inuced Liver Injury (DILI): | 0.306 | AMES Toxicity: | 0.986 |
| Rat Oral Acute Toxicity: | 0.925 | Maximum Recommended Daily Dose: | 0.944 |
| Skin Sensitization: | 0.314 | Carcinogencity: | 0.622 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.032 |
| Respiratory Toxicity: | 0.528 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004446 | ![]() |
0.886 | D0IX6I | ![]() |
0.277 | ||
| ENC004392 | ![]() |
0.629 | D0IL7L | ![]() |
0.268 | ||
| ENC004393 | ![]() |
0.604 | D0KR5B | ![]() |
0.268 | ||
| ENC004775 | ![]() |
0.593 | D02JNM | ![]() |
0.265 | ||
| ENC004254 | ![]() |
0.584 | D0I5DS | ![]() |
0.264 | ||
| ENC002240 | ![]() |
0.580 | D0R7JT | ![]() |
0.264 | ||
| ENC003126 | ![]() |
0.570 | D06XHC | ![]() |
0.259 | ||
| ENC003943 | ![]() |
0.561 | D0D1SG | ![]() |
0.259 | ||
| ENC004774 | ![]() |
0.560 | D0Y7IU | ![]() |
0.258 | ||
| ENC002696 | ![]() |
0.556 | D04QNO | ![]() |
0.258 | ||