|
Name |
(1Z,6R,11R,13R,14S,15S,16R,19E,23R,27R)-23-acetyl-27-hydroxy-9,15-dimethylspiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19-triene-14,2'-oxirane]-3,18-dione
|
| Molecular Formula | C29H36O9 | |
| IUPAC Name* |
(1Z,6R,11R,13R,14S,15S,16R,19E,23R,27R)-23-acetyl-27-hydroxy-9,15-dimethylspiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19-triene-14,2'-oxirane]-3,18-dione
|
|
| SMILES |
CC1=C[C@@H]2[C@@]3(CC1)COC(=O)/C=C\4/CCO[C@@]([C@@H]4O)(CC/C=C/C(=O)O[C@H]5[C@]3([C@]6(CO6)[C@@H](C5)O2)C)C(=O)C
|
|
| InChI |
InChI=1S/C29H36O9/c1-17-7-10-27-15-34-24(32)13-19-8-11-35-28(18(2)30,25(19)33)9-5-4-6-23(31)38-20-14-22(37-21(27)12-17)29(16-36-29)26(20,27)3/h4,6,12-13,20-22,25,33H,5,7-11,14-16H2,1-3H3/b6-4+,19-13-/t20-,21-,22-,25-,26-,27-,28+,29+/m1/s1
|
|
| InChIKey |
LXIQXFWXXPJPEE-OICCJBEUSA-N
|
|
| Synonyms |
mytoxin B; 105049-15-8
|
|
| CAS | NA | |
| PubChem CID | 156597133 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 528.6 | ALogp: | 1.4 |
| HBD: | 1 | HBA: | 9 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 121.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 38 | QED Weighted: | 0.31 |
| Caco-2 Permeability: | -5.333 | MDCK Permeability: | 0.00001450 |
| Pgp-inhibitor: | 0.031 | Pgp-substrate: | 0.957 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.868 |
| 30% Bioavailability (F30%): | 0.91 |
| Blood-Brain-Barrier Penetration (BBB): | 0.722 | Plasma Protein Binding (PPB): | 60.08% |
| Volume Distribution (VD): | 0.992 | Fu: | 26.74% |
| CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.852 |
| CYP2C19-inhibitor: | 0.114 | CYP2C19-substrate: | 0.482 |
| CYP2C9-inhibitor: | 0.032 | CYP2C9-substrate: | 0.018 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.038 |
| CYP3A4-inhibitor: | 0.708 | CYP3A4-substrate: | 0.85 |
| Clearance (CL): | 10.623 | Half-life (T1/2): | 0.674 |
| hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.425 |
| Drug-inuced Liver Injury (DILI): | 0.777 | AMES Toxicity: | 0.982 |
| Rat Oral Acute Toxicity: | 0.957 | Maximum Recommended Daily Dose: | 0.916 |
| Skin Sensitization: | 0.32 | Carcinogencity: | 0.714 |
| Eye Corrosion: | 0.168 | Eye Irritation: | 0.075 |
| Respiratory Toxicity: | 0.092 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002026 | ![]() |
0.886 | D06XHC | ![]() |
0.264 | ||
| ENC004392 | ![]() |
0.683 | D0Q4SD | ![]() |
0.258 | ||
| ENC004393 | ![]() |
0.669 | D0EP0C | ![]() |
0.255 | ||
| ENC004254 | ![]() |
0.646 | D04GJN | ![]() |
0.252 | ||
| ENC002240 | ![]() |
0.606 | D09WYX | ![]() |
0.244 | ||
| ENC003126 | ![]() |
0.595 | D0I2SD | ![]() |
0.243 | ||
| ENC004774 | ![]() |
0.585 | D0V2JK | ![]() |
0.241 | ||
| ENC004775 | ![]() |
0.582 | D06AEO | ![]() |
0.238 | ||
| ENC002696 | ![]() |
0.580 | D0P0HT | ![]() |
0.236 | ||
| ENC003943 | ![]() |
0.574 | D0K7HU | ![]() |
0.236 | ||