![]() |
Name |
(12S,13R,17R,18Z,20E,24S,25S,26R)-12-hydroxy-17-[(1R)-1-hydroxyethyl]-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione
|
Molecular Formula | C29H40O9 | |
IUPAC Name* |
(12S,13R,17R,18Z,20E,24S,25S,26R)-12-hydroxy-17-[(1R)-1-hydroxyethyl]-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione
|
|
SMILES |
C[C@@H]1CCO[C@H](/C=C\C=C\C(=O)O[C@H]2CC3[C@@]4([C@]2(C5(CCC(=CC5O3)C)COC(=O)[C@H]1O)C)CO4)[C@@H](C)O
|
|
InChI |
InChI=1S/C29H40O9/c1-17-9-11-28-15-35-26(33)25(32)18(2)10-12-34-20(19(3)30)7-5-6-8-24(31)38-21-14-23(37-22(28)13-17)29(16-36-29)27(21,28)4/h5-8,13,18-23,25,30,32H,9-12,14-16H2,1-4H3/b7-5-,8-6+/t18-,19-,20-,21+,22?,23?,25+,27-,28?,29-/m1/s1
|
|
InChIKey |
NSFWWJIQIKBZMJ-RSQRSRAHSA-N
|
|
Synonyms |
Roridin A; 14729-29-4
|
|
CAS | 14729-29-4 | |
PubChem CID | 101593058 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 532.6 | ALogp: | 2.2 |
HBD: | 2 | HBA: | 9 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 124.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 38 | QED Weighted: | 0.298 |
Caco-2 Permeability: | -5.09 | MDCK Permeability: | 0.00001590 |
Pgp-inhibitor: | 0.025 | Pgp-substrate: | 0.963 |
Human Intestinal Absorption (HIA): | 0.051 | 20% Bioavailability (F20%): | 0.033 |
30% Bioavailability (F30%): | 0.348 |
Blood-Brain-Barrier Penetration (BBB): | 0.138 | Plasma Protein Binding (PPB): | 86.32% |
Volume Distribution (VD): | 1.868 | Fu: | 8.55% |
CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.216 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.783 |
CYP2C9-inhibitor: | 0.018 | CYP2C9-substrate: | 0.019 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.143 |
CYP3A4-inhibitor: | 0.472 | CYP3A4-substrate: | 0.572 |
Clearance (CL): | 2.31 | Half-life (T1/2): | 0.718 |
hERG Blockers: | 0.558 | Human Hepatotoxicity (H-HT): | 0.569 |
Drug-inuced Liver Injury (DILI): | 0.19 | AMES Toxicity: | 0.114 |
Rat Oral Acute Toxicity: | 0.921 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.616 | Carcinogencity: | 0.355 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.936 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004774 | ![]() |
0.767 | D0K7HU | ![]() |
0.237 | ||
ENC003126 | ![]() |
0.763 | D09YHJ | ![]() |
0.237 | ||
ENC004775 | ![]() |
0.744 | D0Y7IU | ![]() |
0.232 | ||
ENC003943 | ![]() |
0.690 | D04QNO | ![]() |
0.232 | ||
ENC002696 | ![]() |
0.609 | D02JNM | ![]() |
0.230 | ||
ENC002240 | ![]() |
0.586 | D09WYX | ![]() |
0.229 | ||
ENC002050 | ![]() |
0.565 | D0W2EK | ![]() |
0.228 | ||
ENC003310 | ![]() |
0.541 | D0CZ1Q | ![]() |
0.228 | ||
ENC004446 | ![]() |
0.529 | D04SFH | ![]() |
0.227 | ||
ENC002026 | ![]() |
0.518 | D0Z4ZT | ![]() |
0.221 |