|
Name |
Myrothecine I
|
| Molecular Formula | C29H36O9 | |
| IUPAC Name* |
(1R,2S,3R,6Z,10S,14E,19R,23S,24R,26R,29R)-10-acetyl-1,29-dihydroxy-2,22-dimethyl-4,11,17,25-tetraoxahexacyclo[21.3.1.13,26.110,14.02,19.019,24]nonacosa-6,14,21-triene-5,16-dione
|
|
| SMILES |
CC1=CC[C@]23COC(=O)/C=C/4\CCO[C@]([C@@H]4O)(CC/C=C\C(=O)O[C@H]5[C@]2([C@@]6(C[C@@H]1[C@H]3O[C@@H]6C5)O)C)C(=O)C
|
|
| InChI |
InChI=1S/C29H36O9/c1-16-7-10-27-15-35-23(32)12-18-8-11-36-28(17(2)30,24(18)33)9-5-4-6-22(31)37-20-13-21-29(34,26(20,27)3)14-19(16)25(27)38-21/h4,6-7,12,19-21,24-25,33-34H,5,8-11,13-15H2,1-3H3/b6-4-,18-12+/t19-,20+,21+,24+,25+,26+,27+,28+,29-/m0/s1
|
|
| InChIKey |
IXGFBXJXGPNGBN-ROKWFXBWSA-N
|
|
| Synonyms |
Myrothecine I
|
|
| CAS | NA | |
| PubChem CID | 156582484 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 528.6 | ALogp: | 1.1 |
| HBD: | 2 | HBA: | 9 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 129.0 | Aromatic Rings: | 7 |
| Heavy Atoms: | 38 | QED Weighted: | 0.39 |
| Caco-2 Permeability: | -5.333 | MDCK Permeability: | 0.00001150 |
| Pgp-inhibitor: | 0.063 | Pgp-substrate: | 0.794 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.143 |
| 30% Bioavailability (F30%): | 0.902 |
| Blood-Brain-Barrier Penetration (BBB): | 0.625 | Plasma Protein Binding (PPB): | 72.29% |
| Volume Distribution (VD): | 0.985 | Fu: | 18.87% |
| CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.553 |
| CYP2C19-inhibitor: | 0.045 | CYP2C19-substrate: | 0.508 |
| CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.039 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.061 |
| CYP3A4-inhibitor: | 0.735 | CYP3A4-substrate: | 0.72 |
| Clearance (CL): | 7.383 | Half-life (T1/2): | 0.769 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.315 |
| Drug-inuced Liver Injury (DILI): | 0.685 | AMES Toxicity: | 0.398 |
| Rat Oral Acute Toxicity: | 0.713 | Maximum Recommended Daily Dose: | 0.926 |
| Skin Sensitization: | 0.117 | Carcinogencity: | 0.777 |
| Eye Corrosion: | 0.817 | Eye Irritation: | 0.177 |
| Respiratory Toxicity: | 0.032 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004392 | ![]() |
0.812 | D06XHC | ![]() |
0.264 | ||
| ENC004254 | ![]() |
0.754 | D0P0HT | ![]() |
0.262 | ||
| ENC004446 | ![]() |
0.669 | D09WYX | ![]() |
0.260 | ||
| ENC002026 | ![]() |
0.604 | D02JNM | ![]() |
0.253 | ||
| ENC003310 | ![]() |
0.595 | D0Q4SD | ![]() |
0.250 | ||
| ENC003943 | ![]() |
0.427 | D0Y7IU | ![]() |
0.247 | ||
| ENC004774 | ![]() |
0.411 | D04QNO | ![]() |
0.247 | ||
| ENC002240 | ![]() |
0.407 | D06AEO | ![]() |
0.246 | ||
| ENC004775 | ![]() |
0.404 | D02CNR | ![]() |
0.245 | ||
| ENC003126 | ![]() |
0.403 | D0M2QH | ![]() |
0.244 | ||