![]() |
Name |
Alteryulactone
|
Molecular Formula | C14H10O6 | |
IUPAC Name* |
2,3,8,10-tetrahydroxy-5H-benzo[d][2]benzoxepin-7-one
|
|
SMILES |
C1C2=CC(=C(C=C2C3=C(C(=CC(=C3)O)O)C(=O)O1)O)O
|
|
InChI |
InChI=1S/C14H10O6/c15-7-2-9-8-4-11(17)10(16)1-6(8)5-20-14(19)13(9)12(18)3-7/h1-4,15-18H,5H2
|
|
InChIKey |
OXOMHQLEJGIXES-UHFFFAOYSA-N
|
|
Synonyms |
Alteryulactone
|
|
CAS | NA | |
PubChem CID | 146684378 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 274.22 | ALogp: | 2.1 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.434 |
Caco-2 Permeability: | -5.158 | MDCK Permeability: | 0.00000747 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.94 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.048 | Plasma Protein Binding (PPB): | 94.99% |
Volume Distribution (VD): | 0.642 | Fu: | 3.96% |
CYP1A2-inhibitor: | 0.958 | CYP1A2-substrate: | 0.109 |
CYP2C19-inhibitor: | 0.09 | CYP2C19-substrate: | 0.048 |
CYP2C9-inhibitor: | 0.479 | CYP2C9-substrate: | 0.656 |
CYP2D6-inhibitor: | 0.689 | CYP2D6-substrate: | 0.408 |
CYP3A4-inhibitor: | 0.482 | CYP3A4-substrate: | 0.091 |
Clearance (CL): | 17.523 | Half-life (T1/2): | 0.908 |
hERG Blockers: | 0.11 | Human Hepatotoxicity (H-HT): | 0.06 |
Drug-inuced Liver Injury (DILI): | 0.874 | AMES Toxicity: | 0.676 |
Rat Oral Acute Toxicity: | 0.034 | Maximum Recommended Daily Dose: | 0.123 |
Skin Sensitization: | 0.936 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.049 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002517 | ![]() |
0.766 | D04AIT | ![]() |
0.449 | ||
ENC004389 | ![]() |
0.507 | D0K8KX | ![]() |
0.420 | ||
ENC002296 | ![]() |
0.493 | D07MGA | ![]() |
0.381 | ||
ENC001058 | ![]() |
0.474 | D0AZ8C | ![]() |
0.286 | ||
ENC000094 | ![]() |
0.473 | D0U3YB | ![]() |
0.278 | ||
ENC001068 | ![]() |
0.468 | D07EXH | ![]() |
0.274 | ||
ENC001534 | ![]() |
0.449 | D06TJJ | ![]() |
0.245 | ||
ENC003305 | ![]() |
0.443 | D06GCK | ![]() |
0.240 | ||
ENC000335 | ![]() |
0.442 | D02FCQ | ![]() |
0.228 | ||
ENC001929 | ![]() |
0.432 | D02PMO | ![]() |
0.226 |