|
Name |
Citreorosein
|
| Molecular Formula | C15H10O6 | |
| IUPAC Name* |
1,3,8-trihydroxy-6-(hydroxymethyl)anthracene-9,10-dione
|
|
| SMILES |
C1=C(C=C(C2=C1C(=O)C3=C(C2=O)C(=CC(=C3)O)O)O)CO
|
|
| InChI |
InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2
|
|
| InChIKey |
YQHZABGPIPECSQ-UHFFFAOYSA-N
|
|
| Synonyms |
Citreorosein; Omega-hydroxyemodin; 481-73-2; 1,3,8-trihydroxy-6-(hydroxymethyl)anthracene-9,10-dione; .omega.-Hydroxyemodin; 1,3,8-Trihydroxy-6-hydroxymethylanthraquinone; w-Hydroxyemodin; 9,10-Anthracenedione, 1,3,8-trihydroxy-6-(hydroxymethyl)-; CHEBI:81348; 1,3,8-Trihydroxy-6-(hydroxymethyl)anthra-9,10-quinone; CHEMBL290932; O2H2Z421AP; NSC624612; NSC-624612; 1,3,8-TRIHYDROXY-6-(HYDROXYMETHYL)-9,10-DIHYDROANTHRACENE-9,10-DIONE; Anthraquinone, 1,3,8-trihydroxy-6-(hydroxymethyl)-Hydroxyemodin; NSC 624612; omega-Hydroxyemodin; CCRIS 1319; UNII-O2H2Z421AP; HYDROXYEMODIN; HYDROXYEMODIN, .OMEGA.-; SCHEMBL18048123; ACon1_001349; GTPL11005; DTXSID60197420; ZINC5812872; BDBM50020376; AKOS028108661; NCGC00180600-01; C17810; F21513; 3-(4-TERT-BUTYL-PHENOXY)-BENZYL-HYDRAZINE; BRD-K95337480-001-01-4; Q27155287; 1,3,8-TRIHYDROXY-6-(HYDROXYMETHYL)ANTHRAQUINONE; 1,3,8-Trihydroxy-6-(hydroxymethyl)-9,10-Anthracenedione; ANTHRAQUINONE, 1,3,8-TRIHYDROXY-6-(HYDROXYMETHYL)-
|
|
| CAS | 481-73-2 | |
| PubChem CID | 361512 | |
| ChEMBL ID | CHEMBL290932 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 286.24 | ALogp: | 1.5 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 115.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.539 |
| Caco-2 Permeability: | -5.581 | MDCK Permeability: | 0.00000400 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.872 | 20% Bioavailability (F20%): | 0.93 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 94.74% |
| Volume Distribution (VD): | 0.533 | Fu: | 7.74% |
| CYP1A2-inhibitor: | 0.953 | CYP1A2-substrate: | 0.112 |
| CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.048 |
| CYP2C9-inhibitor: | 0.456 | CYP2C9-substrate: | 0.421 |
| CYP2D6-inhibitor: | 0.074 | CYP2D6-substrate: | 0.164 |
| CYP3A4-inhibitor: | 0.115 | CYP3A4-substrate: | 0.022 |
| Clearance (CL): | 7.044 | Half-life (T1/2): | 0.906 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.073 |
| Drug-inuced Liver Injury (DILI): | 0.352 | AMES Toxicity: | 0.428 |
| Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.912 |
| Skin Sensitization: | 0.94 | Carcinogencity: | 0.031 |
| Eye Corrosion: | 0.081 | Eye Irritation: | 0.924 |
| Respiratory Toxicity: | 0.728 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005602 | ![]() |
0.773 | D04AIT | ![]() |
0.369 | ||
| ENC001971 | ![]() |
0.773 | D0K8KX | ![]() |
0.360 | ||
| ENC000913 | ![]() |
0.773 | D07MGA | ![]() |
0.341 | ||
| ENC001497 | ![]() |
0.773 | D0AZ8C | ![]() |
0.303 | ||
| ENC000094 | ![]() |
0.762 | D0R3JB | ![]() |
0.289 | ||
| ENC002296 | ![]() |
0.632 | D0N1FS | ![]() |
0.287 | ||
| ENC002229 | ![]() |
0.627 | D07EXH | ![]() |
0.266 | ||
| ENC005489 | ![]() |
0.627 | D0U3YB | ![]() |
0.258 | ||
| ENC001929 | ![]() |
0.616 | D08FPM | ![]() |
0.254 | ||
| ENC000335 | ![]() |
0.614 | D04XEG | ![]() |
0.242 | ||