|
Name |
Catenarin
|
| Molecular Formula | C15H10O6 | |
| IUPAC Name* |
1,4,5,7-tetrahydroxy-2-methylanthracene-9,10-dione
|
|
| SMILES |
CC1=CC(=C2C(=C1O)C(=O)C3=C(C2=O)C(=CC(=C3)O)O)O
|
|
| InChI |
InChI=1S/C15H10O6/c1-5-2-8(17)11-12(13(5)19)14(20)7-3-6(16)4-9(18)10(7)15(11)21/h2-4,16-19H,1H3
|
|
| InChIKey |
VWDXGKUTGQJJHJ-UHFFFAOYSA-N
|
|
| Synonyms |
CATENARIN; 476-46-0; Caterarin; Katenarin; 4-Hydroxyemodin; 1,4,5,7-tetrahydroxy-2-methylanthracene-9,10-dione; 1,4,6,8-TETRAHYDROXY-3-METHYLANTHRAQUINONE; 1,4,5,7-Tetrahydroxy-2-methylanthraquinone; Anthraquinone, 1,4,5,7-tetrahydroxy-2-methyl-; EHN5P96V6S; 9,10-Anthracenedione, 1,4,5,7-tetrahydroxy-2-methyl-; 9,10-ANTHRACENEDIONE, 2-METHYL-1,4,5,7-TETRAHYDROXY-; NSC-344022; CCRIS 5308; NSC 344022; BRN 2061086; UNII-EHN5P96V6S; 4-08-00-03687 (Beilstein Handbook Reference); CHEMBL29860; SCHEMBL9175437; DTXSID50197212; ZINC5461939; NSC344022; 9, 1,4,5,7-tetrahydroxy-2-methyl-; DB-051464; Anthraquinone,4,5,7-tetrahydroxy-2-methyl-; FT-0632184; TETRAHYDROXY-2-METHYLANTHRAQUINONE, 1,4,5,7-; 1,4,5,7-tetrahydroxy-2-methyl-anthracene-9,10-dione; 1,4,5,7-Tetrahydroxy-2-methylanthra-9,10-quinone #; 1,4,5,7-TETRAHYDROXY-2-METHYL-9,10-ANTHRACENEDIONE; 1,4,5,7-tetrahydroxy-2-methyl-9,10-dihydroanthracene-9,10-dione
|
|
| CAS | 476-46-0 | |
| PubChem CID | 10150 | |
| ChEMBL ID | CHEMBL29860 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 286.24 | ALogp: | 2.9 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 115.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.471 |
| Caco-2 Permeability: | -5.244 | MDCK Permeability: | 0.00000906 |
| Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.174 | 20% Bioavailability (F20%): | 0.476 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 98.66% |
| Volume Distribution (VD): | 0.37 | Fu: | 4.40% |
| CYP1A2-inhibitor: | 0.965 | CYP1A2-substrate: | 0.155 |
| CYP2C19-inhibitor: | 0.087 | CYP2C19-substrate: | 0.055 |
| CYP2C9-inhibitor: | 0.643 | CYP2C9-substrate: | 0.481 |
| CYP2D6-inhibitor: | 0.391 | CYP2D6-substrate: | 0.17 |
| CYP3A4-inhibitor: | 0.333 | CYP3A4-substrate: | 0.078 |
| Clearance (CL): | 8.585 | Half-life (T1/2): | 0.853 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.483 |
| Drug-inuced Liver Injury (DILI): | 0.915 | AMES Toxicity: | 0.775 |
| Rat Oral Acute Toxicity: | 0.216 | Maximum Recommended Daily Dose: | 0.942 |
| Skin Sensitization: | 0.94 | Carcinogencity: | 0.499 |
| Eye Corrosion: | 0.013 | Eye Irritation: | 0.941 |
| Respiratory Toxicity: | 0.158 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000336 | ![]() |
0.769 | D0K8KX | ![]() |
0.381 | ||
| ENC000094 | ![]() |
0.667 | D04AIT | ![]() |
0.357 | ||
| ENC000935 | ![]() |
0.648 | D07MGA | ![]() |
0.345 | ||
| ENC002296 | ![]() |
0.642 | D0AZ8C | ![]() |
0.283 | ||
| ENC001929 | ![]() |
0.625 | D01XWG | ![]() |
0.282 | ||
| ENC001058 | ![]() |
0.614 | D0R3JB | ![]() |
0.281 | ||
| ENC002067 | ![]() |
0.582 | D0C9XJ | ![]() |
0.276 | ||
| ENC005279 | ![]() |
0.577 | D07VLY | ![]() |
0.276 | ||
| ENC000966 | ![]() |
0.575 | D07EXH | ![]() |
0.270 | ||
| ENC000571 | ![]() |
0.554 | D0N1FS | ![]() |
0.265 | ||