|
Name |
cyclo[N-methyl-L-alanyl-beta-alanyl-(2R)-2-hydroxy-4-methylpentanoyl-(3S)-3-methyl-L-prolyl-L-isoleucyl-N-methyl-L-isoleucyl]
|
| Molecular Formula | C32H55N5O7 | |
| IUPAC Name* |
(3R,10S,13S,16S,19S,20S)-13,16-bis[(2S)-butan-2-yl]-10,11,14,20-tetramethyl-3-(2-methylpropyl)-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone
|
|
| SMILES |
CC[C@H](C)[C@H]1C(=O)N([C@H](C(=O)N([C@H](C(=O)NCCC(=O)O[C@@H](C(=O)N2CC[C@@H]([C@H]2C(=O)N1)C)CC(C)C)C)C)[C@@H](C)CC)C
|
|
| InChI |
InChI=1S/C32H55N5O7/c1-11-19(5)25-31(42)36(10)27(20(6)12-2)32(43)35(9)22(8)28(39)33-15-13-24(38)44-23(17-18(3)4)30(41)37-16-14-21(7)26(37)29(40)34-25/h18-23,25-27H,11-17H2,1-10H3,(H,33,39)(H,34,40)/t19-,20-,21-,22-,23+,25-,26-,27-/m0/s1
|
|
| InChIKey |
AIPPDKJKKDOWTJ-MKUQIKACSA-N
|
|
| Synonyms |
Homodestcardin; 917382-84-4; cyclo[N-methyl-L-alanyl-beta-alanyl-(2R)-2-hydroxy-4-methylpentanoyl-(3S)-3-methyl-L-prolyl-L-isoleucyl-N-methyl-L-isoleucyl]; (3R,10S,13S,16S,19S,20S)-13,16-bis[(2S)-butan-2-yl]-10,11,14,20-tetramethyl-3-(2-methylpropyl)-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone; HY-P3107; CS-0145449
|
|
| CAS | NA | |
| PubChem CID | 139586683 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 621.8 | ALogp: | 3.6 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 145.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 44 | QED Weighted: | 0.434 |
| Caco-2 Permeability: | -5.209 | MDCK Permeability: | 0.00001130 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.591 |
| Human Intestinal Absorption (HIA): | 0.082 | 20% Bioavailability (F20%): | 0.047 |
| 30% Bioavailability (F30%): | 0.506 |
| Blood-Brain-Barrier Penetration (BBB): | 0.126 | Plasma Protein Binding (PPB): | 84.76% |
| Volume Distribution (VD): | 0.607 | Fu: | 3.75% |
| CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.052 |
| CYP2C19-inhibitor: | 0.088 | CYP2C19-substrate: | 0.727 |
| CYP2C9-inhibitor: | 0.095 | CYP2C9-substrate: | 0.055 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.079 |
| CYP3A4-inhibitor: | 0.901 | CYP3A4-substrate: | 0.566 |
| Clearance (CL): | 6.608 | Half-life (T1/2): | 0.661 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.932 |
| Drug-inuced Liver Injury (DILI): | 0.954 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.086 | Maximum Recommended Daily Dose: | 0.303 |
| Skin Sensitization: | 0.096 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.027 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003271 | ![]() |
0.855 | D0O3YF | ![]() |
0.274 | ||
| ENC003645 | ![]() |
0.714 | D0L9HX | ![]() |
0.271 | ||
| ENC003559 | ![]() |
0.390 | D05AFC | ![]() |
0.254 | ||
| ENC002857 | ![]() |
0.388 | D08FJL | ![]() |
0.252 | ||
| ENC005449 | ![]() |
0.388 | D0L7LC | ![]() |
0.251 | ||
| ENC003692 | ![]() |
0.369 | D0P8IV | ![]() |
0.245 | ||
| ENC002484 | ![]() |
0.357 | D02SBQ | ![]() |
0.243 | ||
| ENC002129 | ![]() |
0.355 | D06YFA | ![]() |
0.230 | ||
| ENC002373 | ![]() |
0.353 | D00ZCN | ![]() |
0.230 | ||
| ENC005563 | ![]() |
0.347 | D0D8XY | ![]() |
0.228 | ||