|
Name |
Enniatin A1
|
| Molecular Formula | C35H61N3O9 | |
| IUPAC Name* |
(3S,6R,9S,12R,15S,18R)-3,9-bis[(2S)-butan-2-yl]-4,10,16-trimethyl-6,12,15,18-tetra(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
|
|
| SMILES |
CC[C@H](C)[C@H]1C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)[C@@H](C)CC)C)C(C)C)C(C)C)C)C(C)C
|
|
| InChI |
InChI=1S/C35H61N3O9/c1-16-22(11)25-34(43)46-27(19(5)6)30(39)36(13)24(18(3)4)33(42)45-28(20(7)8)31(40)37(14)26(23(12)17-2)35(44)47-29(21(9)10)32(41)38(25)15/h18-29H,16-17H2,1-15H3/t22-,23-,24-,25-,26-,27+,28+,29+/m0/s1
|
|
| InChIKey |
OWUREPXBPJFMOK-CIRFPNLUSA-N
|
|
| Synonyms |
Enniatin A1; 4530-21-6; Cyclo((2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl); 39458RI529; (3S,6R,9S,12R,15S,18R)-3,9-bis[(2S)-butan-2-yl]-4,10,16-trimethyl-6,12,15,18-tetra(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; (3S,6R,9S,12R,15S,18R)-3,9-di[(2S)-butan-2-yl]-6,12,15,18-tetraisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; CHEBI:64652; DTXSID50891864; UNII-39458RI529; ZINC87528960; BE162721; Q27133363
|
|
| CAS | 4530-21-6 | |
| PubChem CID | 57339253 | |
| ChEMBL ID | CHEMBL450707 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 667.9 | ALogp: | 7.3 |
| HBD: | 0 | HBA: | 9 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 140.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 47 | QED Weighted: | 0.269 |
| Caco-2 Permeability: | -5.13 | MDCK Permeability: | 0.00003010 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.029 |
| Human Intestinal Absorption (HIA): | 0.857 | 20% Bioavailability (F20%): | 0.307 |
| 30% Bioavailability (F30%): | 0.442 |
| Blood-Brain-Barrier Penetration (BBB): | 0.033 | Plasma Protein Binding (PPB): | 92.05% |
| Volume Distribution (VD): | 1.243 | Fu: | 2.20% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.058 |
| CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.933 |
| CYP2C9-inhibitor: | 0.061 | CYP2C9-substrate: | 0.028 |
| CYP2D6-inhibitor: | 0.06 | CYP2D6-substrate: | 0.075 |
| CYP3A4-inhibitor: | 0.479 | CYP3A4-substrate: | 0.914 |
| Clearance (CL): | 6.167 | Half-life (T1/2): | 0.04 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.983 |
| Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.011 |
| Skin Sensitization: | 0.027 | Carcinogencity: | 0.006 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.021 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003559 | ![]() |
0.913 | D0O3YF | ![]() |
0.294 | ||
| ENC002129 | ![]() |
0.911 | D0L9HX | ![]() |
0.291 | ||
| ENC000948 | ![]() |
0.828 | D0P8IV | ![]() |
0.281 | ||
| ENC005449 | ![]() |
0.465 | D0L7LC | ![]() |
0.198 | ||
| ENC002627 | ![]() |
0.430 | D05AFC | ![]() |
0.190 | ||
| ENC003706 | ![]() |
0.388 | D0J7XL | ![]() |
0.177 | ||
| ENC001481 | ![]() |
0.384 | D09HNR | ![]() |
0.173 | ||
| ENC003645 | ![]() |
0.341 | D0K7NQ | ![]() |
0.170 | ||
| ENC003271 | ![]() |
0.330 | D08FJL | ![]() |
0.167 | ||
| ENC003254 | ![]() |
0.286 | D02SBQ | ![]() |
0.167 | ||