|
Name |
cyclo[DL-N(Me)Ile-D-OVal-N(Me)Ile-D-OVal-N(Me)Ile-D-OVal]
|
| Molecular Formula | C36H63N3O9 | |
| IUPAC Name* |
(3S,6R,9S,12R,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
|
|
| SMILES |
CC[C@H](C)[C@H]1C(=O)O[C@@H](C(=O)N(C(C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)[C@@H](C)CC)C)C(C)C)[C@@H](C)CC)C)C(C)C
|
|
| InChI |
InChI=1S/C36H63N3O9/c1-16-22(10)25-34(43)46-29(20(6)7)32(41)38(14)27(24(12)18-3)36(45)48-30(21(8)9)33(42)39(15)26(23(11)17-2)35(44)47-28(19(4)5)31(40)37(25)13/h19-30H,16-18H2,1-15H3/t22-,23-,24-,25-,26-,27?,28+,29+,30+/m0/s1
|
|
| InChIKey |
TWHBYJSVDCWICV-LIOIOPIISA-N
|
|
| Synonyms |
Enniatin A; DTXSID90891863; HY-N6702; CS-0093385
|
|
| CAS | 2503-13-1 | |
| PubChem CID | 138394329 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 681.9 | ALogp: | 7.6 |
| HBD: | 0 | HBA: | 9 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 140.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 48 | QED Weighted: | 0.246 |
| Caco-2 Permeability: | -5.115 | MDCK Permeability: | 0.00002620 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.056 |
| Human Intestinal Absorption (HIA): | 0.861 | 20% Bioavailability (F20%): | 0.508 |
| 30% Bioavailability (F30%): | 0.518 |
| Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 91.57% |
| Volume Distribution (VD): | 1.282 | Fu: | 2.86% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.07 |
| CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.938 |
| CYP2C9-inhibitor: | 0.062 | CYP2C9-substrate: | 0.023 |
| CYP2D6-inhibitor: | 0.067 | CYP2D6-substrate: | 0.067 |
| CYP3A4-inhibitor: | 0.625 | CYP3A4-substrate: | 0.917 |
| Clearance (CL): | 6.456 | Half-life (T1/2): | 0.04 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.97 |
| Drug-inuced Liver Injury (DILI): | 0.983 | AMES Toxicity: | 0.012 |
| Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.01 |
| Skin Sensitization: | 0.025 | Carcinogencity: | 0.006 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.016 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002857 | ![]() |
0.913 | D0O3YF | ![]() |
0.286 | ||
| ENC002129 | ![]() |
0.832 | D0L9HX | ![]() |
0.283 | ||
| ENC000948 | ![]() |
0.756 | D0P8IV | ![]() |
0.265 | ||
| ENC005449 | ![]() |
0.465 | D0L7LC | ![]() |
0.195 | ||
| ENC002627 | ![]() |
0.431 | D05AFC | ![]() |
0.192 | ||
| ENC003706 | ![]() |
0.390 | D0J7XL | ![]() |
0.179 | ||
| ENC001481 | ![]() |
0.385 | D09HNR | ![]() |
0.176 | ||
| ENC003645 | ![]() |
0.343 | D0K7NQ | ![]() |
0.172 | ||
| ENC003271 | ![]() |
0.331 | D08FJL | ![]() |
0.170 | ||
| ENC003254 | ![]() |
0.288 | D02SBQ | ![]() |
0.169 | ||