|
Name |
Enniatin B1
|
| Molecular Formula | C34H59N3O9 | |
| IUPAC Name* |
(3S,6R,9S,12R,15S,18R)-3-[(2S)-butan-2-yl]-4,10,16-trimethyl-6,9,12,15,18-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
|
|
| SMILES |
CC[C@H](C)[C@H]1C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C
|
|
| InChI |
InChI=1S/C34H59N3O9/c1-16-22(12)25-34(43)46-27(20(8)9)30(39)36(14)23(17(2)3)32(41)44-26(19(6)7)29(38)35(13)24(18(4)5)33(42)45-28(21(10)11)31(40)37(25)15/h17-28H,16H2,1-15H3/t22-,23-,24-,25-,26+,27+,28+/m0/s1
|
|
| InChIKey |
UQCSETXJXJTMKO-UMURLBKASA-N
|
|
| Synonyms |
Enniatin B1; 19914-20-6; I1MZD05X9S; (3S,6R,9S,12R,15S,18R)-3-[(2S)-butan-2-yl]-4,10,16-trimethyl-6,9,12,15,18-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; Cyclo((2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl); Cyclo[(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl]; UNII-I1MZD05X9S; CHEMBL446318; DTXSID70891861; HY-N3807; ZINC49823175; BE162723; CS-0024255; J-012868; Q27280257
|
|
| CAS | 19914-20-6 | |
| PubChem CID | 11262300 | |
| ChEMBL ID | CHEMBL446318 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 653.8 | ALogp: | 6.9 |
| HBD: | 0 | HBA: | 9 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 140.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 46 | QED Weighted: | 0.291 |
| Caco-2 Permeability: | -5.18 | MDCK Permeability: | 0.00003790 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.051 |
| Human Intestinal Absorption (HIA): | 0.908 | 20% Bioavailability (F20%): | 0.089 |
| 30% Bioavailability (F30%): | 0.396 |
| Blood-Brain-Barrier Penetration (BBB): | 0.038 | Plasma Protein Binding (PPB): | 90.33% |
| Volume Distribution (VD): | 1.26 | Fu: | 3.02% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.052 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.928 |
| CYP2C9-inhibitor: | 0.058 | CYP2C9-substrate: | 0.041 |
| CYP2D6-inhibitor: | 0.068 | CYP2D6-substrate: | 0.076 |
| CYP3A4-inhibitor: | 0.443 | CYP3A4-substrate: | 0.914 |
| Clearance (CL): | 5.968 | Half-life (T1/2): | 0.047 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.981 |
| Drug-inuced Liver Injury (DILI): | 0.988 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.012 |
| Skin Sensitization: | 0.018 | Carcinogencity: | 0.002 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.012 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002857 | ![]() |
0.911 | D0O3YF | ![]() |
0.297 | ||
| ENC000948 | ![]() |
0.909 | D0L9HX | ![]() |
0.294 | ||
| ENC003559 | ![]() |
0.832 | D0P8IV | ![]() |
0.293 | ||
| ENC002627 | ![]() |
0.429 | D0L7LC | ![]() |
0.201 | ||
| ENC005449 | ![]() |
0.424 | D05AFC | ![]() |
0.181 | ||
| ENC001481 | ![]() |
0.383 | D0J7XL | ![]() |
0.175 | ||
| ENC003706 | ![]() |
0.355 | D09HNR | ![]() |
0.170 | ||
| ENC003645 | ![]() |
0.309 | D0K7NQ | ![]() |
0.168 | ||
| ENC003271 | ![]() |
0.298 | D08FJL | ![]() |
0.165 | ||
| ENC003375 | ![]() |
0.293 | D02SBQ | ![]() |
0.164 | ||