![]() |
Name |
emericellamide A
|
Molecular Formula | C31H55N5O7 | |
IUPAC Name* |
(3S,6S,9S,12S,18R,19R)-3,6,18-trimethyl-9-(2-methylpropyl)-19-[(2S)-octan-2-yl]-12-propan-2-yl-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone
|
|
SMILES |
CCCCCC[C@H](C)[C@@H]1[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O1)C)C)CC(C)C)C(C)C)C
|
|
InChI |
InChI=1S/C31H55N5O7/c1-10-11-12-13-14-19(6)26-20(7)27(38)32-16-24(37)36-25(18(4)5)30(41)35-23(15-17(2)3)29(40)33-21(8)28(39)34-22(9)31(42)43-26/h17-23,25-26H,10-16H2,1-9H3,(H,32,38)(H,33,40)(H,34,39)(H,35,41)(H,36,37)/t19-,20+,21-,22-,23-,25-,26+/m0/s1
|
|
InChIKey |
QURRTAYEASAREY-OOVPVTRWSA-N
|
|
Synonyms |
emericellamide A; CHEBI:64373; (3S,6S,9S,12S,18R,19R)-3,6,18-trimethyl-9-(2-methylpropyl)-19-[(2S)-octan-2-yl]-12-(propan-2-yl)-1-oxa-4,7,10,13,16-pentaazacyclononadecane-2,5,8,11,14,17-hexone; CHEMBL225269; Q27133243
|
|
CAS | NA | |
PubChem CID | 16216151 | |
ChEMBL ID | CHEMBL225269 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 609.8 | ALogp: | 4.9 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 172.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 43 | QED Weighted: | 0.197 |
Caco-2 Permeability: | -5.387 | MDCK Permeability: | 0.00002040 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.983 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.839 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.074 | Plasma Protein Binding (PPB): | 77.20% |
Volume Distribution (VD): | 0.562 | Fu: | 5.29% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.028 |
CYP2C19-inhibitor: | 0.123 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.159 | CYP2C9-substrate: | 0.013 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.051 |
CYP3A4-inhibitor: | 0.652 | CYP3A4-substrate: | 0.136 |
Clearance (CL): | 4.047 | Half-life (T1/2): | 0.575 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.961 |
Drug-inuced Liver Injury (DILI): | 0.324 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.046 | Carcinogencity: | 0.01 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.032 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002514 | ![]() |
0.644 | D0L7LC | ![]() |
0.317 | ||
ENC002515 | ![]() |
0.604 | D0O3YF | ![]() |
0.301 | ||
ENC005273 | ![]() |
0.477 | D0L9HX | ![]() |
0.297 | ||
ENC005275 | ![]() |
0.469 | D0J7XL | ![]() |
0.283 | ||
ENC005469 | ![]() |
0.455 | D0K7NQ | ![]() |
0.283 | ||
ENC003175 | ![]() |
0.455 | D02SBQ | ![]() |
0.266 | ||
ENC005276 | ![]() |
0.455 | D07FEC | ![]() |
0.262 | ||
ENC003254 | ![]() |
0.441 | D0D8XY | ![]() |
0.261 | ||
ENC003950 | ![]() |
0.440 | D09OOV | ![]() |
0.259 | ||
ENC005272 | ![]() |
0.435 | D08FJL | ![]() |
0.254 |