![]() |
Name |
Phomaligol A
|
Molecular Formula | C14H20O6 | |
IUPAC Name* |
[(1R,5R)-5-hydroxy-4-methoxy-1,5-dimethyl-2,6-dioxocyclohex-3-en-1-yl] 2-methylbutanoate
|
|
SMILES |
CCC(C)C(=O)O[C@@]1(C(=O)C=C([C@@](C1=O)(C)O)OC)C
|
|
InChI |
InChI=1S/C14H20O6/c1-6-8(2)11(16)20-14(4)9(15)7-10(19-5)13(3,18)12(14)17/h7-8,18H,6H2,1-5H3/t8?,13-,14-/m1/s1
|
|
InChIKey |
DWJRXSZPSOQYDZ-HQOPCJQPSA-N
|
|
Synonyms |
Phomaligol A; DWJRXSZPSOQYDZ-HQOPCJQPSA-
|
|
CAS | NA | |
PubChem CID | 15265874 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.3 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.9 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.616 |
Caco-2 Permeability: | -4.719 | MDCK Permeability: | 0.00002150 |
Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.908 |
30% Bioavailability (F30%): | 0.589 |
Blood-Brain-Barrier Penetration (BBB): | 0.923 | Plasma Protein Binding (PPB): | 54.87% |
Volume Distribution (VD): | 1.002 | Fu: | 61.67% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.898 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.871 |
CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.044 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.052 |
CYP3A4-inhibitor: | 0.072 | CYP3A4-substrate: | 0.924 |
Clearance (CL): | 4.281 | Half-life (T1/2): | 0.857 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.157 |
Drug-inuced Liver Injury (DILI): | 0.929 | AMES Toxicity: | 0.048 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.104 |
Skin Sensitization: | 0.335 | Carcinogencity: | 0.055 |
Eye Corrosion: | 0.766 | Eye Irritation: | 0.461 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002329 | ![]() |
1.000 | D0WY9N | ![]() |
0.241 | ||
ENC004961 | ![]() |
0.470 | D0A4JK | ![]() |
0.233 | ||
ENC004963 | ![]() |
0.411 | D06TQZ | ![]() |
0.222 | ||
ENC004962 | ![]() |
0.387 | D0I5DS | ![]() |
0.216 | ||
ENC003749 | ![]() |
0.350 | D0X4RS | ![]() |
0.215 | ||
ENC002889 | ![]() |
0.350 | D0I5HV | ![]() |
0.214 | ||
ENC004374 | ![]() |
0.333 | D06WTZ | ![]() |
0.213 | ||
ENC002773 | ![]() |
0.321 | D0C1SF | ![]() |
0.208 | ||
ENC005217 | ![]() |
0.319 | D0IX6I | ![]() |
0.208 | ||
ENC002775 | ![]() |
0.307 | D0IL7L | ![]() |
0.208 |