|
Name |
[2-[8,11-dihydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-pyrano[3,2-a]xanthen-9-yl]-4-methylhexan-3-yl] acetate
|
| Molecular Formula | C30H44O8 | |
| IUPAC Name* |
[2-[8,11-dihydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-pyrano[3,2-a]xanthen-9-yl]-4-methylhexan-3-yl] acetate
|
|
| SMILES |
CCC(C)C(C(C)C1=CC(=C2C(=O)C3C4(CCC(OC4CCC3(OC2=C1O)C)C(C)(C)O)C)O)OC(=O)C
|
|
| InChI |
InChI=1S/C30H44O8/c1-9-15(2)25(36-17(4)31)16(3)18-14-19(32)22-24(34)27-29(7)12-10-20(28(5,6)35)37-21(29)11-13-30(27,8)38-26(22)23(18)33/h14-16,20-21,25,27,32-33,35H,9-13H2,1-8H3
|
|
| InChIKey |
CQQWSAMDCPJWPC-UHFFFAOYSA-N
|
|
| Synonyms |
ISOCOCHLIOQUINONE A; BS-1118
|
|
| CAS | NA | |
| PubChem CID | 156023428 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 532.7 | ALogp: | 5.3 |
| HBD: | 3 | HBA: | 8 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 123.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 38 | QED Weighted: | 0.323 |
| Caco-2 Permeability: | -4.779 | MDCK Permeability: | 0.00001720 |
| Pgp-inhibitor: | 0.989 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.027 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.289 |
| Blood-Brain-Barrier Penetration (BBB): | 0.273 | Plasma Protein Binding (PPB): | 98.84% |
| Volume Distribution (VD): | 0.842 | Fu: | 2.28% |
| CYP1A2-inhibitor: | 0.031 | CYP1A2-substrate: | 0.328 |
| CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.67 |
| CYP2C9-inhibitor: | 0.167 | CYP2C9-substrate: | 0.233 |
| CYP2D6-inhibitor: | 0.267 | CYP2D6-substrate: | 0.141 |
| CYP3A4-inhibitor: | 0.473 | CYP3A4-substrate: | 0.519 |
| Clearance (CL): | 3.302 | Half-life (T1/2): | 0.069 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.515 |
| Drug-inuced Liver Injury (DILI): | 0.381 | AMES Toxicity: | 0.038 |
| Rat Oral Acute Toxicity: | 0.924 | Maximum Recommended Daily Dose: | 0.845 |
| Skin Sensitization: | 0.207 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.053 |
| Respiratory Toxicity: | 0.902 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003006 | ![]() |
0.780 | D0W5LS | ![]() |
0.236 | ||
| ENC005795 | ![]() |
0.717 | D0L7AS | ![]() |
0.232 | ||
| ENC004570 | ![]() |
0.617 | D01CKY | ![]() |
0.232 | ||
| ENC000943 | ![]() |
0.616 | D05CHI | ![]() |
0.231 | ||
| ENC004571 | ![]() |
0.585 | D0Y7LD | ![]() |
0.227 | ||
| ENC004573 | ![]() |
0.523 | D02CJX | ![]() |
0.222 | ||
| ENC005794 | ![]() |
0.493 | D0G4OD | ![]() |
0.220 | ||
| ENC001862 | ![]() |
0.485 | D0X7XG | ![]() |
0.220 | ||
| ENC002182 | ![]() |
0.481 | D0H2JP | ![]() |
0.219 | ||
| ENC004572 | ![]() |
0.481 | D0W2EK | ![]() |
0.219 | ||