|
Name |
Thailandolide B
|
| Molecular Formula | C27H34O8 | |
| IUPAC Name* |
[(1R,5R,6R,14R,15S,17R,22S)-10,15-dihydroxy-6,14,18,18,22-pentamethyl-8,19-dioxo-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10-trien-5-yl] acetate
|
|
| SMILES |
C[C@@H]1[C@@H](C2=C(C(=CC3=C2C[C@@H]4[C@]5(CCC(=O)C([C@@H]5C[C@@H]([C@@]4(O3)C)O)(C)C)C)O)C(=O)O1)OC(=O)C
|
|
| InChI |
InChI=1S/C27H34O8/c1-12-23(34-13(2)28)21-14-9-18-26(5)8-7-19(30)25(3,4)17(26)11-20(31)27(18,6)35-16(14)10-15(29)22(21)24(32)33-12/h10,12,17-18,20,23,29,31H,7-9,11H2,1-6H3/t12-,17+,18-,20+,23+,26+,27-/m1/s1
|
|
| InChIKey |
WBVYOHUPTWNRJD-ZLQXHUGPSA-N
|
|
| Synonyms |
Thailandolide B; 944726-62-9; [(1R,5R,6R,14R,15S,17R,22S)-10,15-dihydroxy-6,14,18,18,22-pentamethyl-8,19-dioxo-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10-trien-5-yl] acetate
|
|
| CAS | NA | |
| PubChem CID | 16757191 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 486.6 | ALogp: | 3.6 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 119.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 35 | QED Weighted: | 0.563 |
| Caco-2 Permeability: | -5.271 | MDCK Permeability: | 0.00001740 |
| Pgp-inhibitor: | 0.851 | Pgp-substrate: | 0.937 |
| Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.013 |
| 30% Bioavailability (F30%): | 0.913 |
| Blood-Brain-Barrier Penetration (BBB): | 0.612 | Plasma Protein Binding (PPB): | 85.00% |
| Volume Distribution (VD): | 1.015 | Fu: | 14.95% |
| CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.549 |
| CYP2C19-inhibitor: | 0.054 | CYP2C19-substrate: | 0.629 |
| CYP2C9-inhibitor: | 0.433 | CYP2C9-substrate: | 0.84 |
| CYP2D6-inhibitor: | 0.118 | CYP2D6-substrate: | 0.185 |
| CYP3A4-inhibitor: | 0.485 | CYP3A4-substrate: | 0.358 |
| Clearance (CL): | 5.604 | Half-life (T1/2): | 0.66 |
| hERG Blockers: | 0.442 | Human Hepatotoxicity (H-HT): | 0.93 |
| Drug-inuced Liver Injury (DILI): | 0.364 | AMES Toxicity: | 0.033 |
| Rat Oral Acute Toxicity: | 0.664 | Maximum Recommended Daily Dose: | 0.958 |
| Skin Sensitization: | 0.115 | Carcinogencity: | 0.054 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
| Respiratory Toxicity: | 0.957 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003163 | ![]() |
0.757 | D0W2EK | ![]() |
0.279 | ||
| ENC003164 | ![]() |
0.593 | D0H2MO | ![]() |
0.260 | ||
| ENC002749 | ![]() |
0.437 | D04SFH | ![]() |
0.256 | ||
| ENC002750 | ![]() |
0.415 | D09WYX | ![]() |
0.255 | ||
| ENC001980 | ![]() |
0.409 | D01XDL | ![]() |
0.255 | ||
| ENC003130 | ![]() |
0.397 | D01XWG | ![]() |
0.255 | ||
| ENC002748 | ![]() |
0.368 | D0Y2YP | ![]() |
0.254 | ||
| ENC005020 | ![]() |
0.358 | D03ZZK | ![]() |
0.253 | ||
| ENC003259 | ![]() |
0.351 | D02JNM | ![]() |
0.248 | ||
| ENC002994 | ![]() |
0.346 | D0P0HT | ![]() |
0.248 | ||