![]() |
Name |
Xylarenone D
|
Molecular Formula | C26H40O7 | |
IUPAC Name* |
[(1aR,4R,7S,7aR,7bR)-1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 2-hydroxy-2-(hydroxymethyl)-4,6-dimethyloctanoate
|
|
SMILES |
CCC(C)CC(C)CC(CO)(C(=O)O[C@@H]1CC[C@@H]([C@@]2(C1=CC(=O)[C@]3([C@@H]2O3)C(=C)CO)C)C)O
|
|
InChI |
InChI=1S/C26H40O7/c1-7-15(2)10-16(3)12-25(31,14-28)23(30)32-20-9-8-17(4)24(6)19(20)11-21(29)26(18(5)13-27)22(24)33-26/h11,15-17,20,22,27-28,31H,5,7-10,12-14H2,1-4,6H3/t15?,16?,17-,20+,22+,24+,25?,26-/m0/s1
|
|
InChIKey |
CDUXJTBXTOQGFF-GKKXYILRSA-N
|
|
Synonyms |
Xylarenone D; CHEBI:69733; CHEMBL1813184; BDBM50448072; Q27138078
|
|
CAS | NA | |
PubChem CID | 53360338 | |
ChEMBL ID | CHEMBL1813184 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 464.6 | ALogp: | 3.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 117.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 33 | QED Weighted: | 0.257 |
Caco-2 Permeability: | -4.944 | MDCK Permeability: | 0.00002420 |
Pgp-inhibitor: | 0.043 | Pgp-substrate: | 0.042 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.84 | Plasma Protein Binding (PPB): | 50.83% |
Volume Distribution (VD): | 0.579 | Fu: | 50.21% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.111 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.786 |
CYP2C9-inhibitor: | 0.04 | CYP2C9-substrate: | 0.033 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.037 |
CYP3A4-inhibitor: | 0.687 | CYP3A4-substrate: | 0.727 |
Clearance (CL): | 4.256 | Half-life (T1/2): | 0.911 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.17 |
Drug-inuced Liver Injury (DILI): | 0.797 | AMES Toxicity: | 0.897 |
Rat Oral Acute Toxicity: | 0.299 | Maximum Recommended Daily Dose: | 0.607 |
Skin Sensitization: | 0.944 | Carcinogencity: | 0.395 |
Eye Corrosion: | 0.032 | Eye Irritation: | 0.127 |
Respiratory Toxicity: | 0.93 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002780 | ![]() |
0.835 | D03SXE | ![]() |
0.241 | ||
ENC002770 | ![]() |
0.727 | D02RQU | ![]() |
0.225 | ||
ENC002482 | ![]() |
0.495 | D08PIQ | ![]() |
0.220 | ||
ENC002137 | ![]() |
0.331 | D08TEJ | ![]() |
0.217 | ||
ENC005060 | ![]() |
0.327 | D0Y7IU | ![]() |
0.217 | ||
ENC002888 | ![]() |
0.265 | D04QNO | ![]() |
0.217 | ||
ENC002887 | ![]() |
0.265 | D03IKT | ![]() |
0.216 | ||
ENC003665 | ![]() |
0.261 | D0CW1P | ![]() |
0.216 | ||
ENC002822 | ![]() |
0.255 | D07DVK | ![]() |
0.216 | ||
ENC003168 | ![]() |
0.250 | D0IT2G | ![]() |
0.216 |