|
Name |
(1S,4R,7S,8aR)-4-[(2E,4E)-6,8-dimethyldeca-2,4-dienoyl]oxy-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid
|
| Molecular Formula | C27H36O6 | |
| IUPAC Name* |
(1S,4R,7S,8aR)-4-[(2E,4E)-6,8-dimethyldeca-2,4-dienoyl]oxy-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid
|
|
| SMILES |
CCC(C)CC(C)/C=C/C=C/C(=O)O[C@@H]1CC[C@@H]([C@@]2(C1=CC(=O)[C@@H](C2)C(=C)C=O)C)C(=O)O
|
|
| InChI |
InChI=1S/C27H36O6/c1-6-17(2)13-18(3)9-7-8-10-25(30)33-24-12-11-21(26(31)32)27(5)15-20(19(4)16-28)23(29)14-22(24)27/h7-10,14,16-18,20-21,24H,4,6,11-13,15H2,1-3,5H3,(H,31,32)/b9-7+,10-8+/t17?,18?,20-,21+,24+,27+/m0/s1
|
|
| InChIKey |
KFNRVRQZGWBRJR-XQLFHWRFSA-N
|
|
| Synonyms |
07H239-A; CHEMBL515687; (1S,4R,7S,8aR)-4-[(2E,4E)-6,8-dimethyldeca-2,4-dienoyl]oxy-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid
|
|
| CAS | NA | |
| PubChem CID | 11294029 | |
| ChEMBL ID | CHEMBL515687 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 456.6 | ALogp: | 4.7 |
| HBD: | 1 | HBA: | 6 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 97.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 33 | QED Weighted: | 0.209 |
| Caco-2 Permeability: | -5.1 | MDCK Permeability: | 0.00002490 |
| Pgp-inhibitor: | 0.077 | Pgp-substrate: | 0.056 |
| Human Intestinal Absorption (HIA): | 0.28 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.004 |
| Blood-Brain-Barrier Penetration (BBB): | 0.513 | Plasma Protein Binding (PPB): | 91.93% |
| Volume Distribution (VD): | 0.23 | Fu: | 2.73% |
| CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.084 |
| CYP2C19-inhibitor: | 0.134 | CYP2C19-substrate: | 0.234 |
| CYP2C9-inhibitor: | 0.678 | CYP2C9-substrate: | 0.925 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.115 |
| CYP3A4-inhibitor: | 0.215 | CYP3A4-substrate: | 0.216 |
| Clearance (CL): | 0.614 | Half-life (T1/2): | 0.898 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.052 |
| Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.032 | Maximum Recommended Daily Dose: | 0.931 |
| Skin Sensitization: | 0.973 | Carcinogencity: | 0.627 |
| Eye Corrosion: | 0.979 | Eye Irritation: | 0.329 |
| Respiratory Toxicity: | 0.939 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004127 | ![]() |
0.385 | D0FG6M | ![]() |
0.259 | ||
| ENC003665 | ![]() |
0.346 | D04SFH | ![]() |
0.227 | ||
| ENC002770 | ![]() |
0.344 | D09IEE | ![]() |
0.225 | ||
| ENC002230 | ![]() |
0.336 | D08TEJ | ![]() |
0.225 | ||
| ENC002816 | ![]() |
0.333 | D02CJX | ![]() |
0.224 | ||
| ENC002779 | ![]() |
0.331 | D01ZOG | ![]() |
0.224 | ||
| ENC004128 | ![]() |
0.304 | D05RXI | ![]() |
0.221 | ||
| ENC003895 | ![]() |
0.293 | D0W5LS | ![]() |
0.221 | ||
| ENC004660 | ![]() |
0.293 | D03KYG | ![]() |
0.221 | ||
| ENC002780 | ![]() |
0.288 | D0I1LH | ![]() |
0.220 | ||