| 
                    Name | 
                         Xylarenone C, (rel)- 
                     | 
                
| Molecular Formula | C26H40O5 | |
| IUPAC Name* | 
                         [(1aR,4R,7S,7aR,7bR)-1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 2,4,6-trimethyloctanoate 
                     | 
                |
| SMILES | 
                         CCC(C)CC(C)CC(C)C(=O)O[C@@H]1CC[C@@H]([C@@]2(C1=CC(=O)[C@]3([C@@H]2O3)C(=C)CO)C)C 
                     | 
                |
| InChI | 
                         InChI=1S/C26H40O5/c1-8-15(2)11-16(3)12-17(4)23(29)30-21-10-9-18(5)25(7)20(21)13-22(28)26(19(6)14-27)24(25)31-26/h13,15-18,21,24,27H,6,8-12,14H2,1-5,7H3/t15?,16?,17?,18-,21+,24+,25+,26-/m0/s1 
                     | 
                |
| InChIKey | 
                         CVLZBOJHINAXHY-VAXWEKKDSA-N 
                     | 
                |
| Synonyms | 
                         Xylarenone C; Xylarenone C, (rel)-; CHEMBL1813183; CHEBI:69732; BDBM50349829; Q27138077 
                     | 
                |
| CAS | NA | |
| PubChem CID | 53344593 | |
| ChEMBL ID | CHEMBL1813183 | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 432.6 | ALogp: | 5.3 | 
| HBD: | 1 | HBA: | 5 | 
| Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected | 
| Polar Surface Area: | 76.1 | Aromatic Rings: | 3 | 
| Heavy Atoms: | 31 | QED Weighted: | 0.312 | 
| Caco-2 Permeability: | -4.834 | MDCK Permeability: | 0.00002460 | 
| Pgp-inhibitor: | 0.868 | Pgp-substrate: | 0.002 | 
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.087 | 
| 30% Bioavailability (F30%): | 0.021 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.908 | Plasma Protein Binding (PPB): | 56.51% | 
| Volume Distribution (VD): | 0.939 | Fu: | 52.99% | 
| CYP1A2-inhibitor: | 0.05 | CYP1A2-substrate: | 0.18 | 
| CYP2C19-inhibitor: | 0.177 | CYP2C19-substrate: | 0.879 | 
| CYP2C9-inhibitor: | 0.273 | CYP2C9-substrate: | 0.034 | 
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.042 | 
| CYP3A4-inhibitor: | 0.878 | CYP3A4-substrate: | 0.779 | 
| Clearance (CL): | 8.639 | Half-life (T1/2): | 0.888 | 
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.249 | 
| Drug-inuced Liver Injury (DILI): | 0.63 | AMES Toxicity: | 0.728 | 
| Rat Oral Acute Toxicity: | 0.134 | Maximum Recommended Daily Dose: | 0.772 | 
| Skin Sensitization: | 0.968 | Carcinogencity: | 0.533 | 
| Eye Corrosion: | 0.864 | Eye Irritation: | 0.879 | 
| Respiratory Toxicity: | 0.973 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002779 | ![]()  | 
                    0.727 | D06WTZ | ![]()  | 
                    0.244 | ||
| ENC002780 | ![]()  | 
                    0.648 | D02RQU | ![]()  | 
                    0.242 | ||
| ENC002482 | ![]()  | 
                    0.506 | D03SXE | ![]()  | 
                    0.241 | ||
| ENC002137 | ![]()  | 
                    0.344 | D08TEJ | ![]()  | 
                    0.226 | ||
| ENC005060 | ![]()  | 
                    0.317 | D0Y7LD | ![]()  | 
                    0.221 | ||
| ENC006099 | ![]()  | 
                    0.308 | D0X2LV | ![]()  | 
                    0.220 | ||
| ENC006098 | ![]()  | 
                    0.304 | D0D2TN | ![]()  | 
                    0.219 | ||
| ENC002887 | ![]()  | 
                    0.285 | D00AEQ | ![]()  | 
                    0.216 | ||
| ENC002888 | ![]()  | 
                    0.285 | D04QNO | ![]()  | 
                    0.216 | ||
| ENC003665 | ![]()  | 
                    0.271 | D0Y7IU | ![]()  | 
                    0.216 | ||