![]() |
Name |
Dihydroauroglaucin
|
Molecular Formula | C19H24O3 | |
IUPAC Name* |
2-[(1E,3E)-hepta-1,3-dienyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde
|
|
SMILES |
CCC/C=C/C=C/C1=C(C=C(C(=C1C=O)O)CC=C(C)C)O
|
|
InChI |
InChI=1S/C19H24O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h6-10,12-13,21-22H,4-5,11H2,1-3H3/b7-6+,9-8+
|
|
InChIKey |
JXIPKNRBDKQMAN-BLHCBFLLSA-N
|
|
Synonyms |
DIHYDROAUROGLAUCIN; Auroglaucin, dihydro-; CHEBI:68190; 854182JP77; 2-(1E,3E)-1,3-Heptadien-1-yl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde; Benzaldehyde, 2-(1E,3E)-1,3-heptadien-1-yl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)-; 77102-91-1; CHEMBL1813665; UNII-854182JP77; Q27136684
|
|
CAS | 77102-91-1 | |
PubChem CID | 51340292 | |
ChEMBL ID | CHEMBL1813665 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 300.4 | ALogp: | 5.8 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 22 | QED Weighted: | 0.315 |
Caco-2 Permeability: | -4.931 | MDCK Permeability: | 0.00002460 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.05 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.051 |
Blood-Brain-Barrier Penetration (BBB): | 0.208 | Plasma Protein Binding (PPB): | 99.68% |
Volume Distribution (VD): | 3.98 | Fu: | 1.07% |
CYP1A2-inhibitor: | 0.944 | CYP1A2-substrate: | 0.832 |
CYP2C19-inhibitor: | 0.199 | CYP2C19-substrate: | 0.552 |
CYP2C9-inhibitor: | 0.454 | CYP2C9-substrate: | 0.95 |
CYP2D6-inhibitor: | 0.373 | CYP2D6-substrate: | 0.894 |
CYP3A4-inhibitor: | 0.489 | CYP3A4-substrate: | 0.189 |
Clearance (CL): | 3.636 | Half-life (T1/2): | 0.342 |
hERG Blockers: | 0.34 | Human Hepatotoxicity (H-HT): | 0.47 |
Drug-inuced Liver Injury (DILI): | 0.677 | AMES Toxicity: | 0.737 |
Rat Oral Acute Toxicity: | 0.783 | Maximum Recommended Daily Dose: | 0.927 |
Skin Sensitization: | 0.965 | Carcinogencity: | 0.734 |
Eye Corrosion: | 0.26 | Eye Irritation: | 0.922 |
Respiratory Toxicity: | 0.883 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002292 | ![]() |
0.714 | D05QDC | ![]() |
0.240 | ||
ENC005183 | ![]() |
0.590 | D0B1IP | ![]() |
0.238 | ||
ENC002291 | ![]() |
0.558 | D0O1UZ | ![]() |
0.218 | ||
ENC000863 | ![]() |
0.519 | D06JGH | ![]() |
0.214 | ||
ENC004246 | ![]() |
0.476 | D06BLQ | ![]() |
0.206 | ||
ENC005507 | ![]() |
0.449 | D0J1VY | ![]() |
0.204 | ||
ENC003327 | ![]() |
0.429 | D03VFL | ![]() |
0.200 | ||
ENC002204 | ![]() |
0.414 | D0U5CE | ![]() |
0.198 | ||
ENC005422 | ![]() |
0.405 | D03LGG | ![]() |
0.198 | ||
ENC004248 | ![]() |
0.392 | D0S7WX | ![]() |
0.194 |