|
Name |
Isotetrahydroauroglaucin
|
| Molecular Formula | C19H26O3 | |
| IUPAC Name* |
2-[(E)-hept-5-enyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde
|
|
| SMILES |
C/C=C/CCCCC1=C(C=C(C(=C1C=O)O)CC=C(C)C)O
|
|
| InChI |
InChI=1S/C19H26O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h4-5,10,12-13,21-22H,6-9,11H2,1-3H3/b5-4+
|
|
| InChIKey |
HBLOFOWPCVDNCG-SNAWJCMRSA-N
|
|
| Synonyms |
isotetrahydroauroglaucin; Auroglaucin, isotetrahydro-; 74886-32-1; PI808Y7L4H; CHEBI:68789; Benzaldehyde, 2-(5E)-5-hepten-1-yl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)-; 2-[(E)-hept-5-enyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde; UNII-PI808Y7L4H; CHEMBL462798; DTXSID501149602; Q27137180; 2-(5E)-5-Hepten-1-yl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde; 2-[(5E)-hept-5-en-1-yl]-3,6-dihydroxy-5-(3-methylbut-2-en-1-yl)benzaldehyde
|
|
| CAS | 74886-32-1 | |
| PubChem CID | 14355116 | |
| ChEMBL ID | CHEMBL462798 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 302.4 | ALogp: | 5.8 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 22 | QED Weighted: | 0.302 |
| Caco-2 Permeability: | -4.848 | MDCK Permeability: | 0.00002690 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.544 |
| Blood-Brain-Barrier Penetration (BBB): | 0.285 | Plasma Protein Binding (PPB): | 98.80% |
| Volume Distribution (VD): | 3.394 | Fu: | 1.47% |
| CYP1A2-inhibitor: | 0.953 | CYP1A2-substrate: | 0.847 |
| CYP2C19-inhibitor: | 0.676 | CYP2C19-substrate: | 0.311 |
| CYP2C9-inhibitor: | 0.692 | CYP2C9-substrate: | 0.978 |
| CYP2D6-inhibitor: | 0.87 | CYP2D6-substrate: | 0.913 |
| CYP3A4-inhibitor: | 0.29 | CYP3A4-substrate: | 0.182 |
| Clearance (CL): | 2.68 | Half-life (T1/2): | 0.473 |
| hERG Blockers: | 0.094 | Human Hepatotoxicity (H-HT): | 0.185 |
| Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.554 |
| Rat Oral Acute Toxicity: | 0.408 | Maximum Recommended Daily Dose: | 0.929 |
| Skin Sensitization: | 0.948 | Carcinogencity: | 0.504 |
| Eye Corrosion: | 0.368 | Eye Irritation: | 0.92 |
| Respiratory Toxicity: | 0.833 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000863 | ![]() |
0.714 | D0U5CE | ![]() |
0.274 | ||
| ENC002292 | ![]() |
0.690 | D03LGG | ![]() |
0.274 | ||
| ENC002728 | ![]() |
0.558 | D0O1UZ | ![]() |
0.255 | ||
| ENC003327 | ![]() |
0.463 | D03VFL | ![]() |
0.221 | ||
| ENC005183 | ![]() |
0.459 | D00FSV | ![]() |
0.218 | ||
| ENC004248 | ![]() |
0.431 | D06JGH | ![]() |
0.214 | ||
| ENC004246 | ![]() |
0.424 | D05XQE | ![]() |
0.212 | ||
| ENC003326 | ![]() |
0.422 | D0P1FO | ![]() |
0.204 | ||
| ENC002204 | ![]() |
0.414 | D06KYN | ![]() |
0.202 | ||
| ENC004247 | ![]() |
0.413 | D06BLQ | ![]() |
0.197 | ||