![]() |
Name |
Tetrahydroauroglaucin
|
Molecular Formula | C19H26O3 | |
IUPAC Name* |
2-[(E)-hept-1-enyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde
|
|
SMILES |
CCCCC/C=C/C1=C(C=C(C(=C1C=O)O)CC=C(C)C)O
|
|
InChI |
InChI=1S/C19H26O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h8-10,12-13,21-22H,4-7,11H2,1-3H3/b9-8+
|
|
InChIKey |
FYGPFTSGVSZKAJ-CMDGGOBGSA-N
|
|
Synonyms |
TETRAHYDROAUROGLAUCIN; Aspergin; CHEMBL1811938; CHEBI:68189; 40434-07-9; 4869C436N3; Gentisaldehyde, 6-(1-heptenyl)-3-(3-methyl-2-butenyl)-; 2-[(E)-hept-1-enyl]-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde; Benzaldehyde, 2-(1-hepten-1-yl)-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)-; 33514-92-0; Tetraydroauroglaucin; UNII-4869C436N3; BDBM50350092; HY-N10284; CS-0373524; Q27136683; 2,5-dihydroxy-3-(3-methyl-2-butenyl)-6-[(1e)-1-heptenyl]-benzaldehyde; 2-[(E)-1-Heptenyl]-3,6-dihydroxy-5-(3-methyl-2-butenyl)benzaldehyde
|
|
CAS | 40434-07-9 | |
PubChem CID | 14355117 | |
ChEMBL ID | CHEMBL1811938 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 302.4 | ALogp: | 6.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 22 | QED Weighted: | 0.294 |
Caco-2 Permeability: | -4.873 | MDCK Permeability: | 0.00002840 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.381 | Plasma Protein Binding (PPB): | 99.32% |
Volume Distribution (VD): | 4.671 | Fu: | 1.12% |
CYP1A2-inhibitor: | 0.958 | CYP1A2-substrate: | 0.725 |
CYP2C19-inhibitor: | 0.527 | CYP2C19-substrate: | 0.499 |
CYP2C9-inhibitor: | 0.656 | CYP2C9-substrate: | 0.964 |
CYP2D6-inhibitor: | 0.691 | CYP2D6-substrate: | 0.888 |
CYP3A4-inhibitor: | 0.43 | CYP3A4-substrate: | 0.141 |
Clearance (CL): | 3.26 | Half-life (T1/2): | 0.321 |
hERG Blockers: | 0.222 | Human Hepatotoxicity (H-HT): | 0.241 |
Drug-inuced Liver Injury (DILI): | 0.435 | AMES Toxicity: | 0.715 |
Rat Oral Acute Toxicity: | 0.754 | Maximum Recommended Daily Dose: | 0.952 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.715 |
Eye Corrosion: | 0.5 | Eye Irritation: | 0.933 |
Respiratory Toxicity: | 0.816 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002728 | ![]() |
0.714 | D0O1UZ | ![]() |
0.281 | ||
ENC002291 | ![]() |
0.690 | D0U5CE | ![]() |
0.274 | ||
ENC000863 | ![]() |
0.644 | D03LGG | ![]() |
0.274 | ||
ENC005183 | ![]() |
0.550 | D0UE9X | ![]() |
0.245 | ||
ENC004248 | ![]() |
0.493 | D0O1TC | ![]() |
0.230 | ||
ENC004380 | ![]() |
0.486 | D0L7AS | ![]() |
0.229 | ||
ENC005507 | ![]() |
0.468 | D0N3NO | ![]() |
0.229 | ||
ENC004246 | ![]() |
0.458 | D06FEA | ![]() |
0.229 | ||
ENC003326 | ![]() |
0.457 | D0P1FO | ![]() |
0.228 | ||
ENC003327 | ![]() |
0.446 | D03VFL | ![]() |
0.221 |