![]() |
Name |
Flavoglaucin
|
Molecular Formula | C19H28O3 | |
IUPAC Name* |
2-heptyl-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde
|
|
SMILES |
CCCCCCCC1=C(C=C(C(=C1C=O)O)CC=C(C)C)O
|
|
InChI |
InChI=1S/C19H28O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h10,12-13,21-22H,4-9,11H2,1-3H3
|
|
InChIKey |
RGRXZGKXEJHPQQ-UHFFFAOYSA-N
|
|
Synonyms |
Flavoglaucin; 523-73-9; 2-heptyl-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde; CHEBI:68188; CCRIS 6491; 6-Heptyl-3-(3-methyl-2-butenyl)gentisaldehyde; CHEMBL1813664; DTXSID60200327; 2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-butenyl)benzaldehyde; ZINC72108660; BS-1106; Q27136682; Benzaldehyde, 2-heptyl-3,6-dihydroxy-5-(3-methyl-2-butenyl)-; NCGC00381406-01!2-heptyl-3,6-dihydroxy-5-(3-methylbut-2-enyl)benzaldehyde
|
|
CAS | 523-73-9 | |
PubChem CID | 119037 | |
ChEMBL ID | CHEMBL1813664 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 304.4 | ALogp: | 6.7 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 22 | QED Weighted: | 0.282 |
Caco-2 Permeability: | -4.693 | MDCK Permeability: | 0.00002730 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.043 |
30% Bioavailability (F30%): | 0.946 |
Blood-Brain-Barrier Penetration (BBB): | 0.567 | Plasma Protein Binding (PPB): | 98.95% |
Volume Distribution (VD): | 5.519 | Fu: | 1.60% |
CYP1A2-inhibitor: | 0.931 | CYP1A2-substrate: | 0.301 |
CYP2C19-inhibitor: | 0.687 | CYP2C19-substrate: | 0.191 |
CYP2C9-inhibitor: | 0.818 | CYP2C9-substrate: | 0.965 |
CYP2D6-inhibitor: | 0.565 | CYP2D6-substrate: | 0.705 |
CYP3A4-inhibitor: | 0.346 | CYP3A4-substrate: | 0.076 |
Clearance (CL): | 5.681 | Half-life (T1/2): | 0.362 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.012 |
Drug-inuced Liver Injury (DILI): | 0.027 | AMES Toxicity: | 0.528 |
Rat Oral Acute Toxicity: | 0.041 | Maximum Recommended Daily Dose: | 0.245 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.216 |
Eye Corrosion: | 0.442 | Eye Irritation: | 0.939 |
Respiratory Toxicity: | 0.6 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002291 | ![]() |
0.714 | D0O1UZ | ![]() |
0.309 | ||
ENC002292 | ![]() |
0.644 | D07UHS | ![]() |
0.258 | ||
ENC002728 | ![]() |
0.519 | D04VKS | ![]() |
0.254 | ||
ENC004248 | ![]() |
0.515 | D0P1FO | ![]() |
0.253 | ||
ENC002935 | ![]() |
0.474 | D0L7AS | ![]() |
0.252 | ||
ENC004247 | ![]() |
0.452 | D00FSV | ![]() |
0.248 | ||
ENC004665 | ![]() |
0.427 | D0MM8N | ![]() |
0.248 | ||
ENC000955 | ![]() |
0.427 | D09ANG | ![]() |
0.241 | ||
ENC005183 | ![]() |
0.425 | D0I4DQ | ![]() |
0.240 | ||
ENC003326 | ![]() |
0.422 | D0O1PH | ![]() |
0.235 |