|
Name |
Chaetopyranin
|
| Molecular Formula | C19H24O4 | |
| IUPAC Name* |
6-hydroxy-2-[(E)-3-hydroxybut-1-enyl]-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5-carbaldehyde
|
|
| SMILES |
CC(/C=C/C1CCC2=C(O1)C=C(C(=C2C=O)O)CC=C(C)C)O
|
|
| InChI |
InChI=1S/C19H24O4/c1-12(2)4-6-14-10-18-16(17(11-20)19(14)22)9-8-15(23-18)7-5-13(3)21/h4-5,7,10-11,13,15,21-22H,6,8-9H2,1-3H3/b7-5+
|
|
| InChIKey |
XWZLFKLXNARMNW-FNORWQNLSA-N
|
|
| Synonyms |
CHAETOPYRANIN; CHEBI:68788; CHEMBL462796; Q27137179; 6-hydroxy-2-[(1E)-3-hydroxybut-1-en-1-yl]-7-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-chromene-5-carbaldehyde; 6-hydroxy-2-[(E)-3-hydroxybut-1-enyl]-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5-carbaldehyde
|
|
| CAS | NA | |
| PubChem CID | 11994820 | |
| ChEMBL ID | CHEMBL462796 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 316.4 | ALogp: | 3.9 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 23 | QED Weighted: | 0.634 |
| Caco-2 Permeability: | -4.884 | MDCK Permeability: | 0.00001260 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.051 |
| Human Intestinal Absorption (HIA): | 0.576 | 20% Bioavailability (F20%): | 0.86 |
| 30% Bioavailability (F30%): | 0.993 |
| Blood-Brain-Barrier Penetration (BBB): | 0.046 | Plasma Protein Binding (PPB): | 97.37% |
| Volume Distribution (VD): | 3.598 | Fu: | 2.92% |
| CYP1A2-inhibitor: | 0.794 | CYP1A2-substrate: | 0.733 |
| CYP2C19-inhibitor: | 0.798 | CYP2C19-substrate: | 0.658 |
| CYP2C9-inhibitor: | 0.428 | CYP2C9-substrate: | 0.91 |
| CYP2D6-inhibitor: | 0.255 | CYP2D6-substrate: | 0.687 |
| CYP3A4-inhibitor: | 0.278 | CYP3A4-substrate: | 0.243 |
| Clearance (CL): | 3.389 | Half-life (T1/2): | 0.456 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.774 |
| Drug-inuced Liver Injury (DILI): | 0.139 | AMES Toxicity: | 0.05 |
| Rat Oral Acute Toxicity: | 0.33 | Maximum Recommended Daily Dose: | 0.887 |
| Skin Sensitization: | 0.248 | Carcinogencity: | 0.166 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.901 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005183 | ![]() |
0.494 | D03VFL | ![]() |
0.216 | ||
| ENC002728 | ![]() |
0.414 | D0W6DG | ![]() |
0.210 | ||
| ENC002291 | ![]() |
0.414 | D06JGH | ![]() |
0.207 | ||
| ENC002292 | ![]() |
0.414 | D0YH0N | ![]() |
0.202 | ||
| ENC003327 | ![]() |
0.382 | D0O1UZ | ![]() |
0.200 | ||
| ENC000863 | ![]() |
0.382 | D0P4MT | ![]() |
0.192 | ||
| ENC004246 | ![]() |
0.378 | D0Q0PR | ![]() |
0.190 | ||
| ENC005353 | ![]() |
0.341 | D0P1FO | ![]() |
0.187 | ||
| ENC004307 | ![]() |
0.333 | D05QDC | ![]() |
0.187 | ||
| ENC004988 | ![]() |
0.329 | D02XSA | ![]() |
0.183 | ||