![]() |
Name |
altersolanol K
|
Molecular Formula | C16H20O7 | |
IUPAC Name* |
(1R,2R,3R,4aS,9aR,10R)-1,2,3,5,10-pentahydroxy-7-methoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one
|
|
SMILES |
C[C@]1([C@@H](C[C@H]2[C@H]([C@H]1O)C(=O)C3=C([C@@H]2O)C(=CC(=C3)OC)O)O)O
|
|
InChI |
InChI=1S/C16H20O7/c1-16(22)10(18)5-8-12(15(16)21)14(20)7-3-6(23-2)4-9(17)11(7)13(8)19/h3-4,8,10,12-13,15,17-19,21-22H,5H2,1-2H3/t8-,10+,12-,13+,15+,16+/m0/s1
|
|
InChIKey |
WCDSEXBCUGEBMO-YFVPKAEFSA-N
|
|
Synonyms |
altersolanol K; SCHEMBL904367; CHEMBL552249
|
|
CAS | NA | |
PubChem CID | 42639665 | |
ChEMBL ID | CHEMBL552249 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 324.32 | ALogp: | -1.1 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 127.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.498 |
Caco-2 Permeability: | -5.641 | MDCK Permeability: | 0.00001040 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.934 |
Human Intestinal Absorption (HIA): | 0.725 | 20% Bioavailability (F20%): | 0.029 |
30% Bioavailability (F30%): | 0.869 |
Blood-Brain-Barrier Penetration (BBB): | 0.631 | Plasma Protein Binding (PPB): | 69.92% |
Volume Distribution (VD): | 1.184 | Fu: | 27.19% |
CYP1A2-inhibitor: | 0.067 | CYP1A2-substrate: | 0.116 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.586 |
CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.84 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.24 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.161 |
Clearance (CL): | 3.834 | Half-life (T1/2): | 0.458 |
hERG Blockers: | 0.165 | Human Hepatotoxicity (H-HT): | 0.453 |
Drug-inuced Liver Injury (DILI): | 0.26 | AMES Toxicity: | 0.36 |
Rat Oral Acute Toxicity: | 0.439 | Maximum Recommended Daily Dose: | 0.928 |
Skin Sensitization: | 0.3 | Carcinogencity: | 0.007 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.068 |
Respiratory Toxicity: | 0.603 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002081 | ![]() |
0.690 | D0R9WP | ![]() |
0.261 | ||
ENC002598 | ![]() |
0.627 | D0Z1FX | ![]() |
0.250 | ||
ENC002510 | ![]() |
0.531 | D0S0LZ | ![]() |
0.239 | ||
ENC002898 | ![]() |
0.519 | D07VLY | ![]() |
0.237 | ||
ENC000783 | ![]() |
0.494 | D0C9XJ | ![]() |
0.237 | ||
ENC002488 | ![]() |
0.476 | D0I9HF | ![]() |
0.234 | ||
ENC002522 | ![]() |
0.476 | D01XWG | ![]() |
0.233 | ||
ENC003587 | ![]() |
0.452 | D03DXN | ![]() |
0.231 | ||
ENC005224 | ![]() |
0.452 | D0H1AR | ![]() |
0.229 | ||
ENC000958 | ![]() |
0.452 | D08NQZ | ![]() |
0.229 |