|
Name |
Altersolanol J
|
| Molecular Formula | C16H20O6 | |
| IUPAC Name* |
(2S,3R,4aS,9aS,10R)-2,3,5,10-tetrahydroxy-7-methoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one
|
|
| SMILES |
C[C@@]1(C[C@H]2[C@H](C[C@H]1O)[C@H](C3=C(C2=O)C=C(C=C3O)OC)O)O
|
|
| InChI |
InChI=1S/C16H20O6/c1-16(21)6-10-8(5-12(16)18)15(20)13-9(14(10)19)3-7(22-2)4-11(13)17/h3-4,8,10,12,15,17-18,20-21H,5-6H2,1-2H3/t8-,10-,12+,15+,16-/m0/s1
|
|
| InChIKey |
QJPIXVDUWUJAIT-YLHGYNODSA-N
|
|
| Synonyms |
ALTERSOLANOL J; CHEMBL449194; SCHEMBL2791844; (2S)-1,2,3,4,4abeta,9,9aalpha,10-Octahydro-2alpha,3alpha,5,10beta-tetrahydroxy-2-methyl-7-methoxyanthracene-9-one
|
|
| CAS | NA | |
| PubChem CID | 10913856 | |
| ChEMBL ID | CHEMBL449194 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 308.33 | ALogp: | -0.1 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 22 | QED Weighted: | 0.62 |
| Caco-2 Permeability: | -5.333 | MDCK Permeability: | 0.00000702 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.414 |
| Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.088 |
| Blood-Brain-Barrier Penetration (BBB): | 0.578 | Plasma Protein Binding (PPB): | 75.22% |
| Volume Distribution (VD): | 1.057 | Fu: | 16.05% |
| CYP1A2-inhibitor: | 0.101 | CYP1A2-substrate: | 0.6 |
| CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.76 |
| CYP2C9-inhibitor: | 0.029 | CYP2C9-substrate: | 0.827 |
| CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.306 |
| CYP3A4-inhibitor: | 0.105 | CYP3A4-substrate: | 0.236 |
| Clearance (CL): | 6.68 | Half-life (T1/2): | 0.41 |
| hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.318 |
| Drug-inuced Liver Injury (DILI): | 0.118 | AMES Toxicity: | 0.041 |
| Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.79 |
| Skin Sensitization: | 0.189 | Carcinogencity: | 0.025 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.109 |
| Respiratory Toxicity: | 0.4 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002597 | ![]() |
0.690 | D0R9WP | ![]() |
0.265 | ||
| ENC002898 | ![]() |
0.662 | D0Z1FX | ![]() |
0.255 | ||
| ENC005224 | ![]() |
0.558 | D03DXN | ![]() |
0.248 | ||
| ENC002598 | ![]() |
0.519 | D01XWG | ![]() |
0.246 | ||
| ENC004679 | ![]() |
0.463 | D03BLF | ![]() |
0.241 | ||
| ENC003587 | ![]() |
0.463 | D0C9XJ | ![]() |
0.241 | ||
| ENC002159 | ![]() |
0.450 | D07VLY | ![]() |
0.241 | ||
| ENC002607 | ![]() |
0.450 | D0T7ZQ | ![]() |
0.240 | ||
| ENC002695 | ![]() |
0.450 | D0J1ML | ![]() |
0.240 | ||
| ENC000958 | ![]() |
0.446 | D01XDL | ![]() |
0.236 | ||