|
Name |
Ampelanol
|
| Molecular Formula | C16H20O8 | |
| IUPAC Name* |
(1S,2R,3S,4R,4aS,9aR,10R)-1,2,3,4,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,4a,9a,10-hexahydroanthracen-9-one
|
|
| SMILES |
C[C@@]1([C@@H]([C@H]2[C@H]([C@@H]([C@H]1O)O)C(=O)C3=C([C@@H]2O)C=C(C=C3O)OC)O)O
|
|
| InChI |
InChI=1S/C16H20O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,9-11,13-15,17-18,20-23H,1-2H3/t9-,10-,11-,13-,14+,15+,16-/m0/s1
|
|
| InChIKey |
WYVKBAUSAOYEHR-DQJRHUNDSA-N
|
|
| Synonyms |
Ampelanol; CHEMBL2011666; (1S)-1alpha,2beta,3beta,4alpha,8,10beta-Hexahydroxy-3-methyl-6-methoxy-1,2,3,4,4abeta,9,9aalpha,10-octahydroanthracene-9-one
|
|
| CAS | NA | |
| PubChem CID | 24882470 | |
| ChEMBL ID | CHEMBL2011666 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 340.32 | ALogp: | -1.5 |
| HBD: | 6 | HBA: | 8 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 148.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.391 |
| Caco-2 Permeability: | -5.815 | MDCK Permeability: | 0.00000333 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.963 |
| Human Intestinal Absorption (HIA): | 0.825 | 20% Bioavailability (F20%): | 0.078 |
| 30% Bioavailability (F30%): | 0.98 |
| Blood-Brain-Barrier Penetration (BBB): | 0.216 | Plasma Protein Binding (PPB): | 56.36% |
| Volume Distribution (VD): | 1.567 | Fu: | 33.00% |
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.08 |
| CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.396 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.157 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.135 |
| CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.071 |
| Clearance (CL): | 3.001 | Half-life (T1/2): | 0.359 |
| hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.126 |
| Drug-inuced Liver Injury (DILI): | 0.578 | AMES Toxicity: | 0.391 |
| Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.041 |
| Skin Sensitization: | 0.438 | Carcinogencity: | 0.027 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.284 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002598 | ![]() |
0.699 | D0I9HF | ![]() |
0.275 | ||
| ENC002898 | ![]() |
0.544 | D0S0LZ | ![]() |
0.267 | ||
| ENC002597 | ![]() |
0.531 | D0J2NK | ![]() |
0.252 | ||
| ENC002488 | ![]() |
0.500 | D0AZ8C | ![]() |
0.238 | ||
| ENC002522 | ![]() |
0.500 | D0R9WP | ![]() |
0.235 | ||
| ENC000783 | ![]() |
0.482 | D0H1AR | ![]() |
0.235 | ||
| ENC006047 | ![]() |
0.472 | D0TC7C | ![]() |
0.234 | ||
| ENC002669 | ![]() |
0.452 | D07JHH | ![]() |
0.231 | ||
| ENC002081 | ![]() |
0.435 | D07MGA | ![]() |
0.228 | ||
| ENC006046 | ![]() |
0.434 | D0Z1FX | ![]() |
0.220 | ||