|
Name |
Dactylariol
|
| Molecular Formula | C16H16O7 | |
| IUPAC Name* |
(2R,3R,4R)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione
|
|
| SMILES |
C[C@]1([C@@H](CC2=C([C@H]1O)C(=O)C3=C(C2=O)C(=CC(=C3)OC)O)O)O
|
|
| InChI |
InChI=1S/C16H16O7/c1-16(22)10(18)5-8-12(15(16)21)14(20)7-3-6(23-2)4-9(17)11(7)13(8)19/h3-4,10,15,17-18,21-22H,5H2,1-2H3/t10-,15-,16-/m1/s1
|
|
| InChIKey |
VEGRZYSJCNPLRM-UHNFBRDESA-N
|
|
| Synonyms |
Dactylariol; Altersolanol C; 67022-41-7; 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,5-tetrahydroxy-7-methoxy-2-methyl-, (1R-(1alpha,2beta,3beta))-; CHEMBL2011670; DTXSID40217231; (2R,3R,4R)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione
|
|
| CAS | 67022-41-7 | |
| PubChem CID | 171817 | |
| ChEMBL ID | CHEMBL2011670 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 320.29 | ALogp: | -0.2 |
| HBD: | 4 | HBA: | 7 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 124.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 23 | QED Weighted: | 0.589 |
| Caco-2 Permeability: | -5.565 | MDCK Permeability: | 0.00000503 |
| Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.02 |
| Human Intestinal Absorption (HIA): | 0.9 | 20% Bioavailability (F20%): | 0.185 |
| 30% Bioavailability (F30%): | 0.989 |
| Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 95.74% |
| Volume Distribution (VD): | 0.898 | Fu: | 8.03% |
| CYP1A2-inhibitor: | 0.599 | CYP1A2-substrate: | 0.845 |
| CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.084 |
| CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.503 |
| CYP2D6-inhibitor: | 0.057 | CYP2D6-substrate: | 0.196 |
| CYP3A4-inhibitor: | 0.09 | CYP3A4-substrate: | 0.071 |
| Clearance (CL): | 7.366 | Half-life (T1/2): | 0.735 |
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.057 |
| Drug-inuced Liver Injury (DILI): | 0.73 | AMES Toxicity: | 0.649 |
| Rat Oral Acute Toxicity: | 0.033 | Maximum Recommended Daily Dose: | 0.158 |
| Skin Sensitization: | 0.88 | Carcinogencity: | 0.018 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.159 |
| Respiratory Toxicity: | 0.288 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000783 | ![]() |
0.699 | D07MGA | ![]() |
0.298 | ||
| ENC004679 | ![]() |
0.694 | D01XWG | ![]() |
0.262 | ||
| ENC000941 | ![]() |
0.690 | D08NQZ | ![]() |
0.261 | ||
| ENC003587 | ![]() |
0.671 | D0R9WP | ![]() |
0.261 | ||
| ENC000880 | ![]() |
0.573 | D0H1AR | ![]() |
0.261 | ||
| ENC005363 | ![]() |
0.506 | D0R6RC | ![]() |
0.256 | ||
| ENC003228 | ![]() |
0.506 | D0J2NK | ![]() |
0.256 | ||
| ENC003511 | ![]() |
0.488 | D07VLY | ![]() |
0.256 | ||
| ENC005156 | ![]() |
0.481 | D0C9XJ | ![]() |
0.256 | ||
| ENC002709 | ![]() |
0.476 | D08LTU | ![]() |
0.254 | ||