|
Name |
Altersolanol A
|
| Molecular Formula | C16H16O8 | |
| IUPAC Name* |
(1S,2R,3S,4R)-1,2,3,4,8-pentahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione
|
|
| SMILES |
C[C@]1([C@@H]([C@H](C2=C([C@H]1O)C(=O)C3=C(C2=O)C(=CC(=C3)OC)O)O)O)O
|
|
| InChI |
InChI=1S/C16H16O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,13-15,17,20-23H,1-2H3/t13-,14+,15+,16-/m0/s1
|
|
| InChIKey |
VSMBLBOUQJNJIL-JJXSEGSLSA-N
|
|
| Synonyms |
Altersolanol A; 22268-16-2; As-A 2; CHEBI:2615; (1S,2R,3S,4R)-1,2,3,4,8-pentahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione; ZS3LU23BE3; AC1L3IB0; AC1Q6I5J; NSC-173943; NSC 173943; UNII-ZS3LU23BE3; CHEMBL512054; SCHEMBL2793105; DTXSID10891800; DTXSID701043575; BDBM50480485; HB3756; A831436; J-014615; Q27105737; (1R,2S,3R,4S)-1,2,3,4-Tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-9,10-anthracenedione; (1R-(1alpha,2beta,3beta,4alpha))-1,2,3,4-Tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-9,10-anthracenedione; (1S,2R,3S,4R)-6-methoxy-3-methyl-1,2,3,4,8-pentakis(oxidanyl)-2,4-dihydro-1H-anthracene-9,10-dione; 116948-40-4; 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-, (1R,2S,3R,4S)-; 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-, (1R-(1alpha,2beta,3beta,4alpha))-; rel-(1R,2S,3R,4S)-1,2,3,4-Tetrahydro-1,2,3,4,5- pentahydroxy-7-methoxy-2-methyl-9,10-anthracenedione
|
|
| CAS | 22268-16-2 | |
| PubChem CID | 89644 | |
| ChEMBL ID | CHEMBL512054 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 336.29 | ALogp: | -1.3 |
| HBD: | 5 | HBA: | 8 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 145.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.458 |
| Caco-2 Permeability: | -6.004 | MDCK Permeability: | 0.00000415 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.235 |
| Human Intestinal Absorption (HIA): | 0.91 | 20% Bioavailability (F20%): | 0.102 |
| 30% Bioavailability (F30%): | 0.988 |
| Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 92.92% |
| Volume Distribution (VD): | 1.105 | Fu: | 9.07% |
| CYP1A2-inhibitor: | 0.165 | CYP1A2-substrate: | 0.32 |
| CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.106 |
| CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.436 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.18 |
| CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.043 |
| Clearance (CL): | 2.27 | Half-life (T1/2): | 0.701 |
| hERG Blockers: | 0.049 | Human Hepatotoxicity (H-HT): | 0.038 |
| Drug-inuced Liver Injury (DILI): | 0.906 | AMES Toxicity: | 0.603 |
| Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.024 |
| Skin Sensitization: | 0.43 | Carcinogencity: | 0.011 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.066 |
| Respiratory Toxicity: | 0.073 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004679 | ![]() |
0.722 | D0R9WP | ![]() |
0.278 | ||
| ENC000958 | ![]() |
0.699 | D0H1AR | ![]() |
0.278 | ||
| ENC003587 | ![]() |
0.699 | D0J2NK | ![]() |
0.274 | ||
| ENC005363 | ![]() |
0.551 | D0S0LZ | ![]() |
0.267 | ||
| ENC000941 | ![]() |
0.544 | D08NQZ | ![]() |
0.267 | ||
| ENC005223 | ![]() |
0.525 | D07MGA | ![]() |
0.265 | ||
| ENC000880 | ![]() |
0.500 | D07JHH | ![]() |
0.263 | ||
| ENC002598 | ![]() |
0.494 | D0R6RC | ![]() |
0.263 | ||
| ENC002597 | ![]() |
0.494 | D0C9XJ | ![]() |
0.261 | ||
| ENC002510 | ![]() |
0.482 | D07VLY | ![]() |
0.261 | ||