![]() |
Name |
(3R,4R)-3,4,8-trihydroxy-6-methoxy-3,4-dihydro-1(2H)-naphthalenone
|
Molecular Formula | C11H12O5 | |
IUPAC Name* |
3,4,8-trihydroxy-6-methoxy-3,4-dihydro-2H-naphthalen-1-one
|
|
SMILES |
COc1cc(O)c2c(c1)C(O)C(O)CC2=O
|
|
InChI |
InChI=1S/C11H12O5/c1-16-5-2-6-10(7(12)3-5)8(13)4-9(14)11(6)15/h2-3,9,11-12,14-15H,4H2,1H3/t9-,11-/m1/s1
|
|
InChIKey |
DMURDVUFGONEOC-MWLCHTKSSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 224.21 | ALogp: | 0.4 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.656 |
Caco-2 Permeability: | -4.914 | MDCK Permeability: | 0.00000876 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.776 | 20% Bioavailability (F20%): | 0.872 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.06 | Plasma Protein Binding (PPB): | 80.68% |
Volume Distribution (VD): | 0.724 | Fu: | 16.16% |
CYP1A2-inhibitor: | 0.152 | CYP1A2-substrate: | 0.284 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.081 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.275 |
CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.198 |
CYP3A4-inhibitor: | 0.044 | CYP3A4-substrate: | 0.197 |
Clearance (CL): | 16.209 | Half-life (T1/2): | 0.896 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.084 |
Drug-inuced Liver Injury (DILI): | 0.828 | AMES Toxicity: | 0.671 |
Rat Oral Acute Toxicity: | 0.104 | Maximum Recommended Daily Dose: | 0.182 |
Skin Sensitization: | 0.944 | Carcinogencity: | 0.242 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.765 |
Respiratory Toxicity: | 0.639 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006046 | ![]() |
0.745 | D07MGA | ![]() |
0.351 | ||
ENC003216 | ![]() |
0.694 | D0I9HF | ![]() |
0.248 | ||
ENC005853 | ![]() |
0.694 | D0E9CD | ![]() |
0.237 | ||
ENC002936 | ![]() |
0.694 | D09PJX | ![]() |
0.230 | ||
ENC006107 | ![]() |
0.694 | D0AZ8C | ![]() |
0.226 | ||
ENC006045 | ![]() |
0.649 | D0DJ1B | ![]() |
0.216 | ||
ENC002669 | ![]() |
0.593 | D0Z1FX | ![]() |
0.214 | ||
ENC002782 | ![]() |
0.569 | D04UTT | ![]() |
0.210 | ||
ENC003267 | ![]() |
0.558 | D0D4HN | ![]() |
0.208 | ||
ENC002593 | ![]() |
0.558 | D02NSF | ![]() |
0.207 |