![]() |
Name |
3-((4-(Diethylamino)-o-tolyl)azo)-1,2-dimethyl-5-phenyl-1H-pyrazolium acetate
|
Molecular Formula | C24H31N5O2 | |
IUPAC Name* |
4-[(1,2-dimethyl-5-phenylpyrazol-2-ium-3-yl)diazenyl]-N,N-diethyl-3-methylaniline;acetate
|
|
SMILES |
CCN(CC)C1=CC(=C(C=C1)N=NC2=[N+](N(C(=C2)C3=CC=CC=C3)C)C)C.CC(=O)[O-]
|
|
InChI |
InChI=1S/C22H28N5.C2H4O2/c1-6-27(7-2)19-13-14-20(17(3)15-19)23-24-22-16-21(25(4)26(22)5)18-11-9-8-10-12-18;1-2(3)4/h8-16H,6-7H2,1-5H3;1H3,(H,3,4)/q+1;/p-1
|
|
InChIKey |
HPZPUJJLIZUXDX-UHFFFAOYSA-M
|
|
Synonyms |
94133-88-7; 3-((4-(Diethylamino)-o-tolyl)azo)-1,2-dimethyl-5-phenyl-1H-pyrazolium acetate; DTXSID60240687; EINECS 302-752-8
|
|
CAS | 94133-88-7 | |
PubChem CID | 16205993 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 421.5 | ALogp: | 3.8 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.434 |
Caco-2 Permeability: | -4.561 | MDCK Permeability: | 0.00001640 |
Pgp-inhibitor: | 0.113 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.575 | 20% Bioavailability (F20%): | 0.98 |
30% Bioavailability (F30%): | 0.954 |
Blood-Brain-Barrier Penetration (BBB): | 0.274 | Plasma Protein Binding (PPB): | 98.66% |
Volume Distribution (VD): | 6.172 | Fu: | 1.44% |
CYP1A2-inhibitor: | 0.811 | CYP1A2-substrate: | 0.942 |
CYP2C19-inhibitor: | 0.574 | CYP2C19-substrate: | 0.922 |
CYP2C9-inhibitor: | 0.063 | CYP2C9-substrate: | 0.421 |
CYP2D6-inhibitor: | 0.29 | CYP2D6-substrate: | 0.918 |
CYP3A4-inhibitor: | 0.179 | CYP3A4-substrate: | 0.841 |
Clearance (CL): | 7.974 | Half-life (T1/2): | 0.446 |
hERG Blockers: | 0.536 | Human Hepatotoxicity (H-HT): | 0.161 |
Drug-inuced Liver Injury (DILI): | 0.798 | AMES Toxicity: | 0.887 |
Rat Oral Acute Toxicity: | 0.271 | Maximum Recommended Daily Dose: | 0.749 |
Skin Sensitization: | 0.792 | Carcinogencity: | 0.751 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.852 |
Respiratory Toxicity: | 0.894 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000732 | ![]() |
0.323 | D0J6WW | ![]() |
0.312 | ||
ENC001354 | ![]() |
0.308 | D0A0SP | ![]() |
0.307 | ||
ENC001393 | ![]() |
0.297 | D05UWI | ![]() |
0.298 | ||
ENC001388 | ![]() |
0.297 | D00PEH | ![]() |
0.294 | ||
ENC002453 | ![]() |
0.289 | D07JVL | ![]() |
0.294 | ||
ENC005036 | ![]() |
0.286 | D0A1PX | ![]() |
0.288 | ||
ENC005603 | ![]() |
0.279 | D04BNP | ![]() |
0.288 | ||
ENC005604 | ![]() |
0.279 | D0Y7EM | ![]() |
0.287 | ||
ENC001307 | ![]() |
0.278 | D0R2OA | ![]() |
0.286 | ||
ENC000672 | ![]() |
0.277 | D09VXM | ![]() |
0.280 |