![]() |
Name |
4-(Diethylamino)benzaldehyde
|
Molecular Formula | C11H15NO | |
IUPAC Name* |
4-(diethylamino)benzaldehyde
|
|
SMILES |
CCN(CC)C1=CC=C(C=C1)C=O
|
|
InChI |
InChI=1S/C11H15NO/c1-3-12(4-2)11-7-5-10(9-13)6-8-11/h5-9H,3-4H2,1-2H3
|
|
InChIKey |
MNFZZNNFORDXSV-UHFFFAOYSA-N
|
|
Synonyms |
4-(Diethylamino)benzaldehyde; 4-Diethylaminobenzaldehyde; 120-21-8; Benzaldehyde, 4-(diethylamino)-; p-(Diethylamino)benzaldehyde; p-Formyl-N,N-diethylaniline; Benzaldehyde, p-(diethylamino)-; 4-(N,N-Diethylamino)benzaldehyde; NSC 8782; p-DIETHYLAMINOBENZALDEHYDE; CHEBI:86194; S640XWL10H; CHEMBL3416563; NSC-8782; 4-(Diethylamino)-Benzaldehyde; p-N,N-diethylaminobenzaldehyde; EINECS 204-377-4; UNII-S640XWL10H; N,N-Diethyl-4-formylaniline; AI3-05886; MFCD00003382; p-Diethylaminobenzaldhyde; DSSTox_CID_1963; p-diethylamino benzaldehyde; p-diethylamino-benzaldehyde; 4-diethylamino benzaldehyde; 4-diethylamino-benzaldehyde; DSSTox_GSID_21963; 4-(diethylamino) benzaldehyde; SCHEMBL195135; 4-N,N-Diethylamino benzaldehyde; DTXSID0021963; 4-Diethylaminobenzaldehyde, 99%; NSC8782; 4-(N,N-diethyl)aminobenzaldehyde; BENZALDEHYDE,4-DIETHYLAMINO; ZINC157147; 4-FORMYL-N,N-DIETHYLANILINE; DIETHYLAMINOBENZALDEHYDE, P-; Tox21_303895; BDBM50076742; STK187548; AKOS000118909; CS-W017361; HY-W016645; PS-6119; SB66335; P-(N,N-DIETHYLAMINO)BENZALDEHYDE; 4-(N,N-DIETHYLAMINE)BENZALDEHYDE; NCGC00357151-01; BP-21432; CAS-120-21-8; DB-041543; D0463; FT-0618338; EN300-18276; A804467; W-108483; Q27158973; Z57772436; F2190-0606
|
|
CAS | 120-21-8 | |
PubChem CID | 67114 | |
ChEMBL ID | CHEMBL3416563 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 177.24 | ALogp: | 2.5 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.659 |
Caco-2 Permeability: | -4.303 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.541 | Plasma Protein Binding (PPB): | 78.52% |
Volume Distribution (VD): | 1.467 | Fu: | 16.49% |
CYP1A2-inhibitor: | 0.966 | CYP1A2-substrate: | 0.841 |
CYP2C19-inhibitor: | 0.608 | CYP2C19-substrate: | 0.325 |
CYP2C9-inhibitor: | 0.122 | CYP2C9-substrate: | 0.351 |
CYP2D6-inhibitor: | 0.068 | CYP2D6-substrate: | 0.306 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.171 |
Clearance (CL): | 7.763 | Half-life (T1/2): | 0.509 |
hERG Blockers: | 0.073 | Human Hepatotoxicity (H-HT): | 0.033 |
Drug-inuced Liver Injury (DILI): | 0.407 | AMES Toxicity: | 0.385 |
Rat Oral Acute Toxicity: | 0.162 | Maximum Recommended Daily Dose: | 0.078 |
Skin Sensitization: | 0.57 | Carcinogencity: | 0.673 |
Eye Corrosion: | 0.949 | Eye Irritation: | 0.995 |
Respiratory Toxicity: | 0.966 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000026 | ![]() |
0.467 | D0U5SI | ![]() |
0.317 | ||
ENC000005 | ![]() |
0.452 | D0TZ1G | ![]() |
0.317 | ||
ENC001393 | ![]() |
0.407 | D0L4JT | ![]() |
0.302 | ||
ENC000034 | ![]() |
0.404 | D0E9CD | ![]() |
0.294 | ||
ENC000222 | ![]() |
0.333 | D0B7OD | ![]() |
0.283 | ||
ENC000414 | ![]() |
0.326 | D02WAB | ![]() |
0.281 | ||
ENC001578 | ![]() |
0.322 | D00FGO | ![]() |
0.275 | ||
ENC001347 | ![]() |
0.320 | D0V8QT | ![]() |
0.271 | ||
ENC001460 | ![]() |
0.314 | D0T3NY | ![]() |
0.262 | ||
ENC000012 | ![]() |
0.311 | D0X4RN | ![]() |
0.262 |