![]() |
Name |
Bauvaroalterin B
|
Molecular Formula | C22H20O3 | |
IUPAC Name* |
1-(2-benzyl-5-hydroxy-3-phenylmethoxyphenyl)ethanone
|
|
SMILES |
CC(=O)c1cc(O)cc(OCc2ccccc2)c1Cc1ccccc1
|
|
InChI |
InChI=1S/C22H20O3/c1-16(23)20-13-19(24)14-22(25-15-18-10-6-3-7-11-18)21(20)12-17-8-4-2-5-9-17/h2-11,13-14,24H,12,15H2,1H3
|
|
InChIKey |
UUKXZCNDPMSJKS-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 332.4 | ALogp: | 4.8 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.633 |
Caco-2 Permeability: | -4.931 | MDCK Permeability: | 0.00002330 |
Pgp-inhibitor: | 0.855 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.959 |
30% Bioavailability (F30%): | 0.379 |
Blood-Brain-Barrier Penetration (BBB): | 0.407 | Plasma Protein Binding (PPB): | 99.41% |
Volume Distribution (VD): | 0.605 | Fu: | 1.45% |
CYP1A2-inhibitor: | 0.909 | CYP1A2-substrate: | 0.223 |
CYP2C19-inhibitor: | 0.971 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.859 | CYP2C9-substrate: | 0.886 |
CYP2D6-inhibitor: | 0.567 | CYP2D6-substrate: | 0.508 |
CYP3A4-inhibitor: | 0.441 | CYP3A4-substrate: | 0.513 |
Clearance (CL): | 11.658 | Half-life (T1/2): | 0.684 |
hERG Blockers: | 0.173 | Human Hepatotoxicity (H-HT): | 0.229 |
Drug-inuced Liver Injury (DILI): | 0.945 | AMES Toxicity: | 0.215 |
Rat Oral Acute Toxicity: | 0.045 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.131 | Carcinogencity: | 0.555 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.576 |
Respiratory Toxicity: | 0.033 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005603 | ![]() |
0.800 | D0G1VX | ![]() |
0.469 | ||
ENC005605 | ![]() |
0.500 | D0T5UL | ![]() |
0.425 | ||
ENC000077 | ![]() |
0.469 | D0H6TP | ![]() |
0.415 | ||
ENC003336 | ![]() |
0.444 | D0KS6W | ![]() |
0.411 | ||
ENC001523 | ![]() |
0.437 | D0J2KV | ![]() |
0.385 | ||
ENC003342 | ![]() |
0.429 | D0M9DC | ![]() |
0.374 | ||
ENC003697 | ![]() |
0.417 | D0X2DK | ![]() |
0.371 | ||
ENC003032 | ![]() |
0.413 | D0E3OF | ![]() |
0.370 | ||
ENC001449 | ![]() |
0.411 | D0D4PB | ![]() |
0.365 | ||
ENC000302 | ![]() |
0.409 | D0H5LK | ![]() |
0.363 |