![]() |
Name |
11Alpha-Methoxycurvularin
|
Molecular Formula | C17H22O6 | |
IUPAC Name* |
(5S,9S)-13,15-dihydroxy-9-methoxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
|
SMILES |
C[C@H]1CCC[C@@H](CC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O)OC
|
|
InChI |
InChI=1S/C17H22O6/c1-10-4-3-5-13(22-2)9-15(20)17-11(7-16(21)23-10)6-12(18)8-14(17)19/h6,8,10,13,18-19H,3-5,7,9H2,1-2H3/t10-,13-/m0/s1
|
|
InChIKey |
LBVPDFGFLMFDPI-GWCFXTLKSA-N
|
|
Synonyms |
11Alpha-Methoxycurvularin; 11-alpha-methoxycurvularin; CHEMBL1643634; ZINC13412695
|
|
CAS | NA | |
PubChem CID | 14829838 | |
ChEMBL ID | CHEMBL1643634 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 322.4 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 23 | QED Weighted: | 0.772 |
Caco-2 Permeability: | -4.667 | MDCK Permeability: | 0.00003840 |
Pgp-inhibitor: | 0.019 | Pgp-substrate: | 0.031 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.818 |
Blood-Brain-Barrier Penetration (BBB): | 0.258 | Plasma Protein Binding (PPB): | 55.74% |
Volume Distribution (VD): | 0.568 | Fu: | 37.87% |
CYP1A2-inhibitor: | 0.269 | CYP1A2-substrate: | 0.114 |
CYP2C19-inhibitor: | 0.075 | CYP2C19-substrate: | 0.107 |
CYP2C9-inhibitor: | 0.165 | CYP2C9-substrate: | 0.77 |
CYP2D6-inhibitor: | 0.389 | CYP2D6-substrate: | 0.224 |
CYP3A4-inhibitor: | 0.565 | CYP3A4-substrate: | 0.229 |
Clearance (CL): | 14.589 | Half-life (T1/2): | 0.855 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.213 |
Drug-inuced Liver Injury (DILI): | 0.899 | AMES Toxicity: | 0.164 |
Rat Oral Acute Toxicity: | 0.149 | Maximum Recommended Daily Dose: | 0.891 |
Skin Sensitization: | 0.787 | Carcinogencity: | 0.685 |
Eye Corrosion: | 0.044 | Eye Irritation: | 0.094 |
Respiratory Toxicity: | 0.769 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005137 | ![]() |
1.000 | D07MGA | ![]() |
0.348 | ||
ENC002313 | ![]() |
1.000 | D04JHN | ![]() |
0.255 | ||
ENC005644 | ![]() |
0.783 | D02NSF | ![]() |
0.250 | ||
ENC000974 | ![]() |
0.783 | D00ZFP | ![]() |
0.250 | ||
ENC001430 | ![]() |
0.681 | D0X5KF | ![]() |
0.248 | ||
ENC003117 | ![]() |
0.653 | D03CQE | ![]() |
0.245 | ||
ENC005642 | ![]() |
0.649 | D03YVO | ![]() |
0.245 | ||
ENC005643 | ![]() |
0.613 | D03SKD | ![]() |
0.243 | ||
ENC001849 | ![]() |
0.613 | D0PG8O | ![]() |
0.241 | ||
ENC005417 | ![]() |
0.613 | D00XHD | ![]() |
0.239 |