|
Name |
11Beta-Methoxycurvularin
|
| Molecular Formula | C17H22O6 | |
| IUPAC Name* |
(5S,9R)-13,15-dihydroxy-9-methoxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
|
| SMILES |
C[C@H]1CCC[C@H](CC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O)OC
|
|
| InChI |
InChI=1S/C17H22O6/c1-10-4-3-5-13(22-2)9-15(20)17-11(7-16(21)23-10)6-12(18)8-14(17)19/h6,8,10,13,18-19H,3-5,7,9H2,1-2H3/t10-,13+/m0/s1
|
|
| InChIKey |
LBVPDFGFLMFDPI-GXFFZTMASA-N
|
|
| Synonyms |
11Beta-Methoxycurvularin; 11-beta-methoxycurvularin; (11beta)-11-Methoxycurvularin; CHEMBL1643633; DTXSID101037178; ZINC13412701; 134933-23-6
|
|
| CAS | 134933-23-6 | |
| PubChem CID | 14829839 | |
| ChEMBL ID | CHEMBL1643633 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 322.4 | ALogp: | 2.5 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 93.1 | Aromatic Rings: | 2 |
| Heavy Atoms: | 23 | QED Weighted: | 0.772 |
| Caco-2 Permeability: | -4.68 | MDCK Permeability: | 0.00003330 |
| Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.024 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.26 |
| Blood-Brain-Barrier Penetration (BBB): | 0.471 | Plasma Protein Binding (PPB): | 56.75% |
| Volume Distribution (VD): | 0.605 | Fu: | 38.71% |
| CYP1A2-inhibitor: | 0.352 | CYP1A2-substrate: | 0.108 |
| CYP2C19-inhibitor: | 0.089 | CYP2C19-substrate: | 0.107 |
| CYP2C9-inhibitor: | 0.249 | CYP2C9-substrate: | 0.842 |
| CYP2D6-inhibitor: | 0.389 | CYP2D6-substrate: | 0.171 |
| CYP3A4-inhibitor: | 0.585 | CYP3A4-substrate: | 0.234 |
| Clearance (CL): | 14.394 | Half-life (T1/2): | 0.845 |
| hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.371 |
| Drug-inuced Liver Injury (DILI): | 0.944 | AMES Toxicity: | 0.191 |
| Rat Oral Acute Toxicity: | 0.324 | Maximum Recommended Daily Dose: | 0.935 |
| Skin Sensitization: | 0.574 | Carcinogencity: | 0.666 |
| Eye Corrosion: | 0.016 | Eye Irritation: | 0.057 |
| Respiratory Toxicity: | 0.65 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005137 | ![]() |
1.000 | D07MGA | ![]() |
0.348 | ||
| ENC002312 | ![]() |
1.000 | D04JHN | ![]() |
0.255 | ||
| ENC005644 | ![]() |
0.783 | D02NSF | ![]() |
0.250 | ||
| ENC001430 | ![]() |
0.681 | D00ZFP | ![]() |
0.250 | ||
| ENC003117 | ![]() |
0.653 | D0X5KF | ![]() |
0.248 | ||
| ENC005642 | ![]() |
0.649 | D03CQE | ![]() |
0.245 | ||
| ENC005417 | ![]() |
0.613 | D03YVO | ![]() |
0.245 | ||
| ENC003140 | ![]() |
0.613 | D03SKD | ![]() |
0.243 | ||
| ENC005643 | ![]() |
0.613 | D0PG8O | ![]() |
0.241 | ||
| ENC005419 | ![]() |
0.613 | D00XHD | ![]() |
0.239 | ||