![]() |
Name |
(5R)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
Molecular Formula | C16H20O5 | |
IUPAC Name* |
(5R)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
|
SMILES |
C[C@@H]1CCCCCC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O
|
|
InChI |
InChI=1S/C16H20O5/c1-10-5-3-2-4-6-13(18)16-11(8-15(20)21-10)7-12(17)9-14(16)19/h7,9-10,17,19H,2-6,8H2,1H3/t10-/m1/s1
|
|
InChIKey |
VDUIGYAPSXCJFC-SNVBAGLBSA-N
|
|
Synonyms |
(R)-Curvularin; Curvularin; ZINC5045477; (5R)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
|
CAS | NA | |
PubChem CID | 638958 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 292.33 | ALogp: | 3.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.715 |
Caco-2 Permeability: | -4.699 | MDCK Permeability: | 0.00003330 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.917 |
30% Bioavailability (F30%): | 0.937 |
Blood-Brain-Barrier Penetration (BBB): | 0.221 | Plasma Protein Binding (PPB): | 80.02% |
Volume Distribution (VD): | 0.841 | Fu: | 25.18% |
CYP1A2-inhibitor: | 0.962 | CYP1A2-substrate: | 0.2 |
CYP2C19-inhibitor: | 0.904 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.85 | CYP2C9-substrate: | 0.947 |
CYP2D6-inhibitor: | 0.879 | CYP2D6-substrate: | 0.266 |
CYP3A4-inhibitor: | 0.773 | CYP3A4-substrate: | 0.156 |
Clearance (CL): | 11.741 | Half-life (T1/2): | 0.871 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.144 |
Drug-inuced Liver Injury (DILI): | 0.86 | AMES Toxicity: | 0.225 |
Rat Oral Acute Toxicity: | 0.188 | Maximum Recommended Daily Dose: | 0.727 |
Skin Sensitization: | 0.661 | Carcinogencity: | 0.435 |
Eye Corrosion: | 0.012 | Eye Irritation: | 0.304 |
Respiratory Toxicity: | 0.443 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000974 | ![]() |
0.710 | D07MGA | ![]() |
0.308 | ||
ENC005644 | ![]() |
0.710 | D07GRH | ![]() |
0.299 | ||
ENC005007 | ![]() |
0.694 | D0P6VV | ![]() |
0.282 | ||
ENC005137 | ![]() |
0.681 | D00ZFP | ![]() |
0.264 | ||
ENC002312 | ![]() |
0.681 | D04JHN | ![]() |
0.255 | ||
ENC002313 | ![]() |
0.681 | D02NSF | ![]() |
0.250 | ||
ENC002286 | ![]() |
0.657 | D03YVO | ![]() |
0.245 | ||
ENC005419 | ![]() |
0.657 | D0T3HY | ![]() |
0.242 | ||
ENC003140 | ![]() |
0.657 | D03WAJ | ![]() |
0.241 | ||
ENC001849 | ![]() |
0.657 | D0PG8O | ![]() |
0.240 |