![]() |
Name |
11beta-Hydroxycurvularin
|
Molecular Formula | C16H20O6 | |
IUPAC Name* |
(5S,9R)-9,13,15-trihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-3,11-dione
|
|
SMILES |
C[C@H]1CCC[C@H](CC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O)O
|
|
InChI |
InChI=1S/C16H20O6/c1-9-3-2-4-11(17)7-13(19)16-10(6-15(21)22-9)5-12(18)8-14(16)20/h5,8-9,11,17-18,20H,2-4,6-7H2,1H3/t9-,11+/m0/s1
|
|
InChIKey |
QPBNFQKLPIXNFL-GXSJLCMTSA-N
|
|
Synonyms |
60821-04-7; 11beta-Hydroxycurvularin; MLS004257383; CHEMBL516578; ACon1_000411; DTXSID80976294; ZINC6037575; NCGC00169104-01; SMR003082514; BRD-K68254834-001-01-7; (4S)-4,5,6,7,8,9-Hexahydro-8beta,11,13-trihydroxy-4-methyl-2H-3-benzoxacyclododecin-2,10(1H)-dione; (4S,8R)-8,11,13-trihydroxy-4-methyl-4,5,6,7,8,9-hexahydro-1H-benzo[d][1]oxacyclododecine-2,10-dione; 2H-3-Benzoxacyclododecin-2,10(1H)-dione, 4,5,6,7,8,9-hexahydro-8,11,13-trihydroxy-4-methyl-, (4S,8R)-; 8,11,13-Trihydroxy-4-methyl-4,5,6,7,8,9-hexahydro-2H-3-benzoxacyclododecine-2,10(1H)-dione
|
|
CAS | 60821-04-7 | |
PubChem CID | 181293 | |
ChEMBL ID | CHEMBL516578 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.33 | ALogp: | 1.9 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.635 |
Caco-2 Permeability: | -4.948 | MDCK Permeability: | 0.00003140 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.964 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.03 |
30% Bioavailability (F30%): | 0.956 |
Blood-Brain-Barrier Penetration (BBB): | 0.279 | Plasma Protein Binding (PPB): | 47.35% |
Volume Distribution (VD): | 0.651 | Fu: | 51.89% |
CYP1A2-inhibitor: | 0.56 | CYP1A2-substrate: | 0.093 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.272 | CYP2C9-substrate: | 0.938 |
CYP2D6-inhibitor: | 0.404 | CYP2D6-substrate: | 0.142 |
CYP3A4-inhibitor: | 0.525 | CYP3A4-substrate: | 0.19 |
Clearance (CL): | 15.755 | Half-life (T1/2): | 0.874 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.191 |
Drug-inuced Liver Injury (DILI): | 0.814 | AMES Toxicity: | 0.143 |
Rat Oral Acute Toxicity: | 0.203 | Maximum Recommended Daily Dose: | 0.955 |
Skin Sensitization: | 0.488 | Carcinogencity: | 0.701 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.101 |
Respiratory Toxicity: | 0.797 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005644 | ![]() |
1.000 | D07MGA | ![]() |
0.344 | ||
ENC005137 | ![]() |
0.783 | D04JHN | ![]() |
0.263 | ||
ENC002312 | ![]() |
0.783 | D00ZFP | ![]() |
0.258 | ||
ENC001430 | ![]() |
0.710 | D02NSF | ![]() |
0.258 | ||
ENC003117 | ![]() |
0.681 | D0Z1FX | ![]() |
0.253 | ||
ENC005642 | ![]() |
0.676 | D03YVO | ![]() |
0.252 | ||
ENC005419 | ![]() |
0.639 | D01KQA | ![]() |
0.252 | ||
ENC005417 | ![]() |
0.639 | D0PG8O | ![]() |
0.248 | ||
ENC005643 | ![]() |
0.639 | D03DXN | ![]() |
0.245 | ||
ENC003140 | ![]() |
0.639 | D08QMX | ![]() |
0.245 |