![]() |
Name |
(3R,5R,9S)-15,17-dihydroxy-9-methyl-4,10-dioxatricyclo[11.4.0.03,5]heptadeca-1(13),14,16-triene-2,11-dione
|
Molecular Formula | C16H18O6 | |
IUPAC Name* |
(3R,5R,9S)-15,17-dihydroxy-9-methyl-4,10-dioxatricyclo[11.4.0.03,5]heptadeca-1(13),14,16-triene-2,11-dione
|
|
SMILES |
C[C@H]1CCC[C@@H]2[C@@H](O2)C(=O)C3=C(CC(=O)O1)C=C(C=C3O)O
|
|
InChI |
InChI=1S/C16H18O6/c1-8-3-2-4-12-16(22-12)15(20)14-9(6-13(19)21-8)5-10(17)7-11(14)18/h5,7-8,12,16-18H,2-4,6H2,1H3/t8-,12+,16+/m0/s1
|
|
InChIKey |
BVDHPBILFRQGEC-FUEZOXIYSA-N
|
|
Synonyms |
10,11-Epoxycurvularin; CHEMBL3983467; ZINC100061686
|
|
CAS | NA | |
PubChem CID | 98050296 | |
ChEMBL ID | CHEMBL3983467 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.31 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.564 |
Caco-2 Permeability: | -4.866 | MDCK Permeability: | 0.00002340 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.447 |
Blood-Brain-Barrier Penetration (BBB): | 0.199 | Plasma Protein Binding (PPB): | 78.32% |
Volume Distribution (VD): | 0.599 | Fu: | 14.42% |
CYP1A2-inhibitor: | 0.409 | CYP1A2-substrate: | 0.095 |
CYP2C19-inhibitor: | 0.173 | CYP2C19-substrate: | 0.074 |
CYP2C9-inhibitor: | 0.282 | CYP2C9-substrate: | 0.822 |
CYP2D6-inhibitor: | 0.607 | CYP2D6-substrate: | 0.233 |
CYP3A4-inhibitor: | 0.645 | CYP3A4-substrate: | 0.195 |
Clearance (CL): | 12.654 | Half-life (T1/2): | 0.762 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.186 |
Drug-inuced Liver Injury (DILI): | 0.867 | AMES Toxicity: | 0.435 |
Rat Oral Acute Toxicity: | 0.705 | Maximum Recommended Daily Dose: | 0.756 |
Skin Sensitization: | 0.633 | Carcinogencity: | 0.683 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.065 |
Respiratory Toxicity: | 0.448 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000974 | ![]() |
0.681 | D07MGA | ![]() |
0.284 | ||
ENC005644 | ![]() |
0.681 | D00ZFP | ![]() |
0.255 | ||
ENC002312 | ![]() |
0.653 | D04JHN | ![]() |
0.247 | ||
ENC002313 | ![]() |
0.653 | D0G6AB | ![]() |
0.242 | ||
ENC005137 | ![]() |
0.653 | D0AZ8C | ![]() |
0.242 | ||
ENC005643 | ![]() |
0.630 | D03YVO | ![]() |
0.239 | ||
ENC005419 | ![]() |
0.630 | D0K7LU | ![]() |
0.236 | ||
ENC001849 | ![]() |
0.630 | D0PG8O | ![]() |
0.234 | ||
ENC002287 | ![]() |
0.630 | D02NSF | ![]() |
0.230 | ||
ENC002286 | ![]() |
0.630 | D08QMX | ![]() |
0.229 |