|
Name |
Fusaricidin B
|
| Molecular Formula | C42H76N10O11 | |
| IUPAC Name* |
N-[(3R,6R,9R,12S,15R,18S,19R)-6-(3-amino-3-oxopropyl)-9-[(1R)-1-hydroxyethyl]-3,19-dimethyl-2,5,8,11,14,17-hexaoxo-12,15-di(propan-2-yl)-1-oxa-4,7,10,13,16-pentazacyclononadec-18-yl]-15-(diaminomethylideneamino)-3-hydroxypentadecanamide
|
|
| SMILES |
C[C@@H]1[C@@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O1)C)CCC(=O)N)[C@@H](C)O)C(C)C)C(C)C)NC(=O)CC(CCCCCCCCCCCCN=C(N)N)O
|
|
| InChI |
InChI=1S/C42H76N10O11/c1-23(2)32-37(58)50-33(24(3)4)38(59)52-34(26(6)53)39(60)48-29(19-20-30(43)55)36(57)47-25(5)41(62)63-27(7)35(40(61)51-32)49-31(56)22-28(54)18-16-14-12-10-8-9-11-13-15-17-21-46-42(44)45/h23-29,32-35,53-54H,8-22H2,1-7H3,(H2,43,55)(H,47,57)(H,48,60)(H,49,56)(H,50,58)(H,51,61)(H,52,59)(H4,44,45,46)/t25-,26-,27-,28?,29-,32-,33+,34-,35+/m1/s1
|
|
| InChIKey |
WDNFMLNXGKOBJN-IOGIGVIJSA-N
|
|
| Synonyms |
Fusaricidin B; N-[(3R,6R,9R,12S,15R,18S,19R)-6-(3-Amino-3-oxopropyl)-9-[(1R)-1-hydroxyethyl]-3,19-dimethyl-2,5,8,11,14,17-hexaoxo-12,15-di(propan-2-yl)-1-oxa-4,7,10,13,16-pentazacyclononadec-18-yl]-15-(diaminomethylideneamino)-3-hydroxypentadecanamide; SCHEMBL630322
|
|
| CAS | NA | |
| PubChem CID | 10748277 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 897.1 | ALogp: | 2.7 |
| HBD: | 11 | HBA: | 12 |
| Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 349.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 63 | QED Weighted: | 0.029 |
| Caco-2 Permeability: | -5.813 | MDCK Permeability: | 0.00005040 |
| Pgp-inhibitor: | 0.619 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.85 | 20% Bioavailability (F20%): | 0.991 |
| 30% Bioavailability (F30%): | 0.995 |
| Blood-Brain-Barrier Penetration (BBB): | 0.043 | Plasma Protein Binding (PPB): | 71.54% |
| Volume Distribution (VD): | 0.478 | Fu: | 19.42% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.007 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.034 |
| CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.003 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.032 |
| CYP3A4-inhibitor: | 0.078 | CYP3A4-substrate: | 0.049 |
| Clearance (CL): | 2.937 | Half-life (T1/2): | 0.377 |
| hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.959 |
| Drug-inuced Liver Injury (DILI): | 0.055 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.059 |
| Skin Sensitization: | 0.042 | Carcinogencity: | 0.005 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
| Respiratory Toxicity: | 0.007 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002406 | ![]() |
0.936 | D0K7NQ | ![]() |
0.354 | ||
| ENC003684 | ![]() |
0.806 | D00ZCN | ![]() |
0.339 | ||
| ENC003716 | ![]() |
0.764 | D09OOV | ![]() |
0.331 | ||
| ENC005275 | ![]() |
0.518 | D02SBQ | ![]() |
0.326 | ||
| ENC003950 | ![]() |
0.504 | D07FEC | ![]() |
0.314 | ||
| ENC005272 | ![]() |
0.493 | D0D8XY | ![]() |
0.310 | ||
| ENC005273 | ![]() |
0.491 | D05HPI | ![]() |
0.310 | ||
| ENC005274 | ![]() |
0.466 | D0M3FJ | ![]() |
0.309 | ||
| ENC005271 | ![]() |
0.451 | D08FJL | ![]() |
0.295 | ||
| ENC001983 | ![]() |
0.427 | D0J7XL | ![]() |
0.291 | ||