|
Name |
cyclo[Asp-D-Leu-Leu-ObAla(3-isododecyl)-Glu-Leu-D-Leu-Val]
|
| Molecular Formula | C53H93N7O13 | |
| IUPAC Name* |
3-[(3S,6R,9S,12S,15R,18S,21S)-9-(carboxymethyl)-3,6,15,18-tetrakis(2-methylpropyl)-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-12-propan-2-yl-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-21-yl]propanoic acid
|
|
| SMILES |
CC(C)CCCCCCCCCC1CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)O1)CC(C)C)CC(C)C)CC(=O)O)C(C)C)CC(C)C)CC(C)C)CCC(=O)O
|
|
| InChI |
InChI=1S/C53H93N7O13/c1-30(2)20-18-16-14-13-15-17-19-21-36-28-43(61)54-37(22-23-44(62)63)47(66)55-38(24-31(3)4)48(67)57-40(26-33(7)8)51(70)60-46(35(11)12)52(71)58-41(29-45(64)65)50(69)56-39(25-32(5)6)49(68)59-42(27-34(9)10)53(72)73-36/h30-42,46H,13-29H2,1-12H3,(H,54,61)(H,55,66)(H,56,69)(H,57,67)(H,58,71)(H,59,68)(H,60,70)(H,62,63)(H,64,65)/t36?,37-,38-,39+,40+,41-,42-,46-/m0/s1
|
|
| InChIKey |
NJGWOFRZMQRKHT-VKBYPPDESA-N
|
|
| Synonyms |
Surfactin; 24730-31-2
|
|
| CAS | 24730-31-2 | |
| PubChem CID | 10129764 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1036.3 | ALogp: | 8.8 |
| HBD: | 9 | HBA: | 13 |
| Rotatable Bonds: | 24 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 305.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 73 | QED Weighted: | 0.043 |
| Caco-2 Permeability: | -5.75 | MDCK Permeability: | 0.00009190 |
| Pgp-inhibitor: | 0.29 | Pgp-substrate: | 0.99 |
| Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.97 |
| 30% Bioavailability (F30%): | 0.934 |
| Blood-Brain-Barrier Penetration (BBB): | 0.006 | Plasma Protein Binding (PPB): | 95.51% |
| Volume Distribution (VD): | 0.398 | Fu: | 3.86% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.003 |
| CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.036 |
| CYP2C9-inhibitor: | 0.159 | CYP2C9-substrate: | 0.998 |
| CYP2D6-inhibitor: | 0.028 | CYP2D6-substrate: | 0.027 |
| CYP3A4-inhibitor: | 0.255 | CYP3A4-substrate: | 0.045 |
| Clearance (CL): | 2.142 | Half-life (T1/2): | 0.747 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.973 |
| Drug-inuced Liver Injury (DILI): | 0.155 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.093 | Maximum Recommended Daily Dose: | 0.93 |
| Skin Sensitization: | 0.136 | Carcinogencity: | 0.068 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.023 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002910 | ![]() |
0.969 | D0K7NQ | ![]() |
0.446 | ||
| ENC003254 | ![]() |
0.485 | D0J7XL | ![]() |
0.403 | ||
| ENC005273 | ![]() |
0.482 | D09OOV | ![]() |
0.384 | ||
| ENC002094 | ![]() |
0.455 | D0Q3BV | ![]() |
0.362 | ||
| ENC005275 | ![]() |
0.452 | D0M1IO | ![]() |
0.357 | ||
| ENC003247 | ![]() |
0.449 | D07FEC | ![]() |
0.356 | ||
| ENC001506 | ![]() |
0.440 | D05HPI | ![]() |
0.337 | ||
| ENC005271 | ![]() |
0.439 | D0O3YF | ![]() |
0.327 | ||
| ENC003950 | ![]() |
0.436 | D0L9HX | ![]() |
0.324 | ||
| ENC005272 | ![]() |
0.432 | D06TFE | ![]() |
0.299 | ||