|
Name |
Glyceryl palmitoleate
|
| Molecular Formula | C19H36O4 | |
| IUPAC Name* |
2,3-dihydroxypropyl (Z)-hexadec-9-enoate
|
|
| SMILES |
CCCCCC/C=C\CCCCCCCC(=O)OCC(CO)O
|
|
| InChI |
InChI=1S/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h7-8,18,20-21H,2-6,9-17H2,1H3/b8-7-
|
|
| InChIKey |
KVYUBFKSKZWZSV-FPLPWBNLSA-N
|
|
| Synonyms |
1-Monopalmitolein; Monopalmitolein; glyceryl palmitoleate; 37515-61-0; 2,3-dihydroxypropyl (Z)-hexadec-9-enoate; 1-Monopalmitoleoyl-rac-glycerol; MG(16:1); Glyceryl 9-hexadecenoate; 1-Palmitoleylglycerol; 1-palmitoleoylglycerol; Monopalmitolein (9c); 1-Mono(cis-9-hexadecenoyl)-rac-glycerol; glyceryl mono-palmitoleate; MG(16:1(9Z)/0:0/0:0); SCHEMBL1932536; 1-[(9Z)-hexadecenoyl]glycerol; CHEMBL2075038; CHEBI:133596; DTXSID601316256; MAG 16:1; 1-Monopalmitoleoyl-rac-glycerol, >=99%; MG(16:1(9Z)); 2,3-dihydroxypropyl (9Z)-hexadec-9-enoate; CS-0135941; MG(16:1/0:0/0:0)
|
|
| CAS | 37515-61-0 | |
| PubChem CID | 9883914 | |
| ChEMBL ID | CHEMBL2075038 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 328.5 | ALogp: | 5.4 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 17 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 0 |
| Heavy Atoms: | 23 | QED Weighted: | 0.244 |
| Caco-2 Permeability: | -4.889 | MDCK Permeability: | 0.00004320 |
| Pgp-inhibitor: | 0.038 | Pgp-substrate: | 0.097 |
| Human Intestinal Absorption (HIA): | 0.088 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.995 |
| Blood-Brain-Barrier Penetration (BBB): | 0.451 | Plasma Protein Binding (PPB): | 96.62% |
| Volume Distribution (VD): | 0.743 | Fu: | 1.80% |
| CYP1A2-inhibitor: | 0.436 | CYP1A2-substrate: | 0.201 |
| CYP2C19-inhibitor: | 0.27 | CYP2C19-substrate: | 0.062 |
| CYP2C9-inhibitor: | 0.361 | CYP2C9-substrate: | 0.88 |
| CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.15 |
| CYP3A4-inhibitor: | 0.619 | CYP3A4-substrate: | 0.099 |
| Clearance (CL): | 8.176 | Half-life (T1/2): | 0.916 |
| hERG Blockers: | 0.239 | Human Hepatotoxicity (H-HT): | 0.059 |
| Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.12 |
| Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.019 |
| Skin Sensitization: | 0.943 | Carcinogencity: | 0.158 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.054 |
| Respiratory Toxicity: | 0.227 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001700 | ![]() |
0.915 | D0O1PH | ![]() |
0.638 | ||
| ENC001670 | ![]() |
0.707 | D0O1TC | ![]() |
0.506 | ||
| ENC001679 | ![]() |
0.707 | D0OR6A | ![]() |
0.446 | ||
| ENC001628 | ![]() |
0.700 | D07ILQ | ![]() |
0.437 | ||
| ENC001435 | ![]() |
0.700 | D0UE9X | ![]() |
0.435 | ||
| ENC001643 | ![]() |
0.696 | D00MLW | ![]() |
0.406 | ||
| ENC001688 | ![]() |
0.689 | D0H2YX | ![]() |
0.396 | ||
| ENC001680 | ![]() |
0.689 | D09SRR | ![]() |
0.373 | ||
| ENC001657 | ![]() |
0.689 | D0Z5SM | ![]() |
0.368 | ||
| ENC000572 | ![]() |
0.689 | D05ATI | ![]() |
0.366 | ||