![]() |
Name |
Methyl oleate
|
Molecular Formula | C19H36O2 | |
IUPAC Name* |
methyl (Z)-octadec-9-enoate
|
|
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10-
|
|
InChIKey |
QYDYPVFESGNLHU-KHPPLWFESA-N
|
|
Synonyms |
METHYL OLEATE; 112-62-9; Oleic acid methyl ester; Methyl cis-9-octadecenoate; Methyl (Z)-9-octadecenoate; Oleic acid, methyl ester; Edenor MeTiO5; Phytorob 926-67; methyl (Z)-octadec-9-enoate; methyl-cis-oleate; Exceparl M-OL; Emery, oleic acid ester; 9-Octadecenoic acid (Z)-, methyl ester; Methyl (9Z)-octadec-9-enoate; Esterol 112; Priolube 1403; Witconol 2301; (Z)-9-Octadecenoic acid, methyl ester; Emerest 2801; Unister M 182A; Emery oleic acid ester 2301; Emery 2301; Edenor Me 90/95V; Methyl oleate, tech grade; Nissan Unister M 182A; 9-Octadecenoic acid (9Z)-, methyl ester; methyloleate; (Z)-9-Octadecenoic acid methyl ester; cis-9-Octyldecenoic acid, methyl ester; Methyl 9-octadecenoate; ADJ 100; Priolube 1400; Oleic acid, methyl ester, cis-; CHEBI:27542; MFCD00009578; 39736AJ06R; NSC-406282; 139152-82-2; 9-Octadecenoic acid (9Z)-, methyl ester, sulfurized, copper-treated; Methyl 9-(Z)-octadecenoate; 61788-34-9; CCRIS 675; HSDB 5572; EINECS 203-992-5; NSC 406282; cis-Methyl oleic acid ester; methyl oleoate; methyl oleat; AI3-00651; UNII-39736AJ06R; Oleic acid, cis-; EINECS 262-969-8; Kemester 205; Methyl oleate, 99%; Oleic acid-methyl ester; Methyl (Z)-9-oleate; DUB OM HTO; AEC METHYL OLEATE; Methyl Z-9-octadecenoate; DSSTox_CID_5811; AGNIQUE ME 181U; Methyl Oleate, 99per cent; DSSTox_RID_77931; (Z)-9-Methyl octadecenoate; DSSTox_GSID_25811; Kemester 213 (Salt/Mix); SCHEMBL37371; Emery 2219 (Salt/Mix); METHYL OLEATE [HSDB]; METHYL OLEATE [INCI]; Emerest 2301 (Salt/Mix); Methyl 9-octadecenoate, cis-; WLN: 9U8VO1-C; CHEMBL465725; METHYL OLEATE [USP-RS]; DTXSID5025811; Methyl (9Z)-9-octadecenoate #; Methyl oleate, analytical standard; HY-N2598; Tox21_200225; 9-Octadecenoic acid (Z)-, methyl ester, sulfurized, copper-treated; cis-9-octadecenoic acid methyl ester; LMFA07010965; NSC406282; s5762; ZINC38141473; Methyl oleate, technical grade, 70%; cis-9-Octadecenoic acid, methyl ester; OLEIC ACID METHYL ESTER (CIS); 9-octadecenoic acid, methyl ester (Z); NCGC00164359-01; NCGC00164359-02; NCGC00257779-01; Octadecenoic acid methyl ester, 9-(Z)-; AC-33784; CAS-112-62-9; CS-0022975; O0055; C03425; E75868; EN300-7407582; W-108642; Q27103186; 1B317D43-CBCA-4348-B5B9-4687B6A3C698; Methyl oleate, United States Pharmacopeia (USP) Reference Standard; Methyl Oleate, Pharmaceutical Secondary Standard; Certified Reference Material
|
|
CAS | 112-62-9 | |
PubChem CID | 5364509 | |
ChEMBL ID | CHEMBL465725 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.5 | ALogp: | 7.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.204 |
Caco-2 Permeability: | -4.824 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.989 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.461 | Plasma Protein Binding (PPB): | 98.07% |
Volume Distribution (VD): | 2.937 | Fu: | 1.50% |
CYP1A2-inhibitor: | 0.436 | CYP1A2-substrate: | 0.245 |
CYP2C19-inhibitor: | 0.42 | CYP2C19-substrate: | 0.102 |
CYP2C9-inhibitor: | 0.258 | CYP2C9-substrate: | 0.946 |
CYP2D6-inhibitor: | 0.427 | CYP2D6-substrate: | 0.314 |
CYP3A4-inhibitor: | 0.609 | CYP3A4-substrate: | 0.084 |
Clearance (CL): | 4.635 | Half-life (T1/2): | 0.765 |
hERG Blockers: | 0.324 | Human Hepatotoxicity (H-HT): | 0.046 |
Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.085 |
Eye Corrosion: | 0.815 | Eye Irritation: | 0.881 |
Respiratory Toxicity: | 0.905 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000572 | ![]() |
1.000 | D0O1PH | ![]() |
0.703 | ||
ENC001682 | ![]() |
1.000 | D0O1TC | ![]() |
0.519 | ||
ENC001680 | ![]() |
1.000 | D07ILQ | ![]() |
0.500 | ||
ENC001540 | ![]() |
1.000 | D0OR6A | ![]() |
0.469 | ||
ENC001657 | ![]() |
1.000 | D0Z5SM | ![]() |
0.462 | ||
ENC001687 | ![]() |
0.935 | D05ATI | ![]() |
0.446 | ||
ENC001627 | ![]() |
0.909 | D0UE9X | ![]() |
0.444 | ||
ENC002275 | ![]() |
0.909 | D00FGR | ![]() |
0.392 | ||
ENC001435 | ![]() |
0.900 | D0H2YX | ![]() |
0.388 | ||
ENC001711 | ![]() |
0.853 | D00MLW | ![]() |
0.385 |