![]() |
Name |
Methyl petroselinate
|
Molecular Formula | C19H36O2 | |
IUPAC Name* |
methyl (Z)-octadec-6-enoate
|
|
SMILES |
CCCCCCCCCCC/C=C\CCCCC(=O)OC
|
|
InChI |
InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h13-14H,3-12,15-18H2,1-2H3/b14-13-
|
|
InChIKey |
QRTVDKVXAFJVRU-YPKPFQOOSA-N
|
|
Synonyms |
Methyl petroselinate; 2777-58-4; Petroselinic acid methyl ester; Methyl cis-6-octadecenoate; Methyl (Z)-octadec-6-enoate; PETROSELINICACIDMETHYLESTER; Methyl 6(Z)-Octadecenoate; 6-Octadecenoic acid, methyl ester, (Z)-; 774W29LWKQ; 6-Octadecenoic acid, methyl ester, (6Z)-; cis-6-Octadecenoic Acid Methyl Ester; UNII-774W29LWKQ; EINECS 220-470-2; Methyl (Z)-6-octadecenoate; SCHEMBL17137615; Methyl (6Z)-6-octadecenoate #; DTXSID701315075; CAA77758; MFCD00673443; ZINC86020533; PETROSELENIC ACID METHYL ESTER; cis-6-Octadecenoic acid, methyl ester; PETROSELINIC ACID, METHYL ESTER; BS-43966; PETROSELINIC ACID METHYL ESTER [MI]; M2306; (Z)-6-OCTADECENOIC ACID METHYL ESTER; Q27266547
|
|
CAS | 2777-58-4 | |
PubChem CID | 5362717 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.5 | ALogp: | 7.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.204 |
Caco-2 Permeability: | -4.824 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.989 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.461 | Plasma Protein Binding (PPB): | 98.07% |
Volume Distribution (VD): | 2.937 | Fu: | 1.50% |
CYP1A2-inhibitor: | 0.436 | CYP1A2-substrate: | 0.245 |
CYP2C19-inhibitor: | 0.42 | CYP2C19-substrate: | 0.102 |
CYP2C9-inhibitor: | 0.258 | CYP2C9-substrate: | 0.946 |
CYP2D6-inhibitor: | 0.427 | CYP2D6-substrate: | 0.314 |
CYP3A4-inhibitor: | 0.609 | CYP3A4-substrate: | 0.084 |
Clearance (CL): | 4.635 | Half-life (T1/2): | 0.765 |
hERG Blockers: | 0.324 | Human Hepatotoxicity (H-HT): | 0.046 |
Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.085 |
Eye Corrosion: | 0.815 | Eye Irritation: | 0.881 |
Respiratory Toxicity: | 0.905 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001688 | ![]() |
1.000 | D0O1PH | ![]() |
0.703 | ||
ENC001687 | ![]() |
0.935 | D0O1TC | ![]() |
0.519 | ||
ENC001627 | ![]() |
0.909 | D07ILQ | ![]() |
0.500 | ||
ENC001435 | ![]() |
0.900 | D0OR6A | ![]() |
0.469 | ||
ENC001714 | ![]() |
0.853 | D0Z5SM | ![]() |
0.462 | ||
ENC001645 | ![]() |
0.850 | D05ATI | ![]() |
0.446 | ||
ENC001670 | ![]() |
0.836 | D0UE9X | ![]() |
0.444 | ||
ENC001678 | ![]() |
0.833 | D00FGR | ![]() |
0.392 | ||
ENC001699 | ![]() |
0.800 | D0H2YX | ![]() |
0.388 | ||
ENC001555 | ![]() |
0.800 | D00MLW | ![]() |
0.385 |