![]() |
Name |
Ethyl oleate
|
Molecular Formula | C20H38O2 | |
IUPAC Name* |
ethyl (Z)-octadec-9-enoate
|
|
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)OCC
|
|
InChI |
InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-
|
|
InChIKey |
LVGKNOAMLMIIKO-QXMHVHEDSA-N
|
|
Synonyms |
Ethyl oleate; 111-62-6; ethyl (Z)-octadec-9-enoate; Oleic acid, ethyl ester; Ethyl cis-9-octadecenoate; Oleic acid ethyl ester; 9-Octadecenoic acid (Z)-, ethyl ester; ETHYLOLEATE; FEMA No. 2450; Ethyl oleate [NF]; MFCD00009579; NSC-229428; ethyl (9Z)-octadec-9-enoate; CHEBI:84940; (Z)-9-Octadecenoic acid ethyl ester; Ethyl oleate (NF); Z2Z439864Y; ethyl octadec-9-enoate; 9-Octadecenoic acid, (Z)-, ethyl ester; Ethyl 9-octadecenoate; 85049-36-1; Ethyl Z-9-octadecenoate; Ethyl oleate (natural); Ethyl 9-octadecenoate, (Z)-; Oleic acid ethyl; UNII-Z2Z439864Y; Ethyl Oleate, NF; EINECS 203-889-5; NSC 229428; Ethyl oleate, 98%; Oleic acid-ethyl ester; 9-Octadecenoic acid (9Z)-, ethyl ester; AI3-00657; ethyl (9Z)-octadecenoate; ETHYL OLEATE [II]; ETHYL OLEATE [FCC]; SCHEMBL2797; DSSTox_CID_27633; DSSTox_RID_82464; ETHYL OLEATE [FHFI]; DSSTox_GSID_47633; ETHYL OLEATE [MART.]; ETHYL OLEATE [USP-RS]; CHEMBL2106289; DTXSID3047633; Ethyl (9Z)-9-octadecenoate #; Ethyl oleate, natural, >=85%; Ethyl oleate, analytical standard; HMS3650O15; ETHYL OLEATE [EP IMPURITY]; ETHYL OLEATE [EP MONOGRAPH]; HY-N7103; ZINC8214560; cis-9-Octadecenoic Acid ethyl ester; Tox21_303521; Ethyl oleate, technical grade, 70%; NSC229428; s5367; AKOS025117011; CCG-267586; CS-W009922; (Z)-Octadec-9-enoic Acid Ethyl Ester; NCGC00257457-01; AC-33783; CAS-111-62-6; Ethyl oleate, tested according to Ph.Eur.; O0054; O0143; Ethyl oleate, Vetec(TM) reagent grade, 98%; D04090; EN300-1724742; A894703; SR-01000946820; Q6578680; SR-01000946820-1; Z2315574852; Ethyl oleate, United States Pharmacopeia (USP) Reference Standard
|
|
CAS | 111-62-6 | |
PubChem CID | 5363269 | |
ChEMBL ID | CHEMBL2106289 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 310.5 | ALogp: | 8.0 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 17 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 22 | QED Weighted: | 0.184 |
Caco-2 Permeability: | -4.838 | MDCK Permeability: | 0.00002690 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.928 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.126 | Plasma Protein Binding (PPB): | 98.47% |
Volume Distribution (VD): | 2.898 | Fu: | 1.10% |
CYP1A2-inhibitor: | 0.373 | CYP1A2-substrate: | 0.199 |
CYP2C19-inhibitor: | 0.457 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.279 | CYP2C9-substrate: | 0.943 |
CYP2D6-inhibitor: | 0.498 | CYP2D6-substrate: | 0.175 |
CYP3A4-inhibitor: | 0.553 | CYP3A4-substrate: | 0.091 |
Clearance (CL): | 4.046 | Half-life (T1/2): | 0.718 |
hERG Blockers: | 0.384 | Human Hepatotoxicity (H-HT): | 0.027 |
Drug-inuced Liver Injury (DILI): | 0.044 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.963 | Carcinogencity: | 0.086 |
Eye Corrosion: | 0.89 | Eye Irritation: | 0.964 |
Respiratory Toxicity: | 0.894 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001679 | ![]() |
1.000 | D0O1PH | ![]() |
0.697 | ||
ENC001540 | ![]() |
0.836 | D0O1TC | ![]() |
0.500 | ||
ENC001688 | ![]() |
0.836 | D07ILQ | ![]() |
0.500 | ||
ENC000572 | ![]() |
0.836 | D0OR6A | ![]() |
0.455 | ||
ENC001682 | ![]() |
0.836 | D0Z5SM | ![]() |
0.444 | ||
ENC001680 | ![]() |
0.836 | D05ATI | ![]() |
0.429 | ||
ENC001657 | ![]() |
0.836 | D0UE9X | ![]() |
0.429 | ||
ENC001627 | ![]() |
0.792 | D00MLW | ![]() |
0.427 | ||
ENC002275 | ![]() |
0.792 | D00FGR | ![]() |
0.394 | ||
ENC001643 | ![]() |
0.784 | D0G2KD | ![]() |
0.389 |