![]() |
Name |
Methyl palmitoleate
|
Molecular Formula | C17H32O2 | |
IUPAC Name* |
methyl (Z)-hexadec-9-enoate
|
|
SMILES |
CCCCCC/C=C\CCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C17H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h8-9H,3-7,10-16H2,1-2H3/b9-8-
|
|
InChIKey |
IZFGRAGOVZCUFB-HJWRWDBZSA-N
|
|
Synonyms |
METHYL PALMITOLEATE; 1120-25-8; (Z)-Methyl hexadec-9-enoate; Methyl (Z)-hexadec-9-enoate; Methyl cis-9-hexadecenoate; methyl (9Z)-hexadec-9-enoate; Palmitoleic acid methyl ester; Methyl palmitoleinate; 9-Hexadecenoic acid, methyl ester, (Z)-; Methyl Z-9-hexadecenoate; Methyl cis-hexadec-9-enoate; Palmitoleic acid-methyl ester; Palmitoleic acid, methyl ester; 35695QDB9F; cis-9-Hexadecenoic Acid Methyl Ester; cis-9-Hexadecenoic acid, methyl ester; WE(1:0/16:1(9Z)); 9-hexadecenoic acid, methyl ester, (9Z)-; UNII-35695QDB9F; methyl palmitioleate; EINECS 214-303-2; MFCD00042911; Methyl cis-palmitoleate; Palmitoleic acid methyl; formyl 9Z-hexadecenoate; Methyl 9Z-hexadecenoate; AI3-36450; (Z)methyl hexadec-9-enoate; SCHEMBL440468; CHEBI:84156; DTXSID00897351; Methyl (9Z)-9-hexadecenoate #; Z9-hexadecenoic acid methyl ester; LMFA07010501; METHYL PALMITOLEATE [USP-RS]; ZINC100006508; CS-W012404; HY-W011688; Methyl palmitoleate, analytical standard; Hexadecenoic acid methyl ester, 9-(Z)-; AC-33776; AS-59087; 9-Hexadecenoic acid,methyl ester, (9Z)-; P1958; C17H32O2 (cis-hexadec-9-enoic acid methyl ester); J-002692; Methyl palmitoleate, >=99% (capillary GC), liquid; Q27157517; 0A07894A-8C05-4940-9DC5-451562B136DF; Methyl palmitoleate, United States Pharmacopeia (USP) Reference Standard
|
|
CAS | 1120-25-8 | |
PubChem CID | 643801 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 268.4 | ALogp: | 6.5 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 19 | QED Weighted: | 0.245 |
Caco-2 Permeability: | -4.771 | MDCK Permeability: | 0.00002780 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.991 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.869 | Plasma Protein Binding (PPB): | 97.37% |
Volume Distribution (VD): | 2.319 | Fu: | 1.89% |
CYP1A2-inhibitor: | 0.753 | CYP1A2-substrate: | 0.445 |
CYP2C19-inhibitor: | 0.508 | CYP2C19-substrate: | 0.189 |
CYP2C9-inhibitor: | 0.375 | CYP2C9-substrate: | 0.938 |
CYP2D6-inhibitor: | 0.33 | CYP2D6-substrate: | 0.403 |
CYP3A4-inhibitor: | 0.65 | CYP3A4-substrate: | 0.105 |
Clearance (CL): | 5.202 | Half-life (T1/2): | 0.841 |
hERG Blockers: | 0.243 | Human Hepatotoxicity (H-HT): | 0.05 |
Drug-inuced Liver Injury (DILI): | 0.049 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.042 | Maximum Recommended Daily Dose: | 0.039 |
Skin Sensitization: | 0.956 | Carcinogencity: | 0.123 |
Eye Corrosion: | 0.846 | Eye Irritation: | 0.885 |
Respiratory Toxicity: | 0.86 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001645 | ![]() |
0.944 | D0O1PH | ![]() |
0.622 | ||
ENC001680 | ![]() |
0.900 | D0O1TC | ![]() |
0.560 | ||
ENC001657 | ![]() |
0.900 | D0OR6A | ![]() |
0.500 | ||
ENC001688 | ![]() |
0.900 | D0UE9X | ![]() |
0.480 | ||
ENC000572 | ![]() |
0.900 | D07ILQ | ![]() |
0.425 | ||
ENC001540 | ![]() |
0.900 | D05ATI | ![]() |
0.423 | ||
ENC001682 | ![]() |
0.900 | D0H2YX | ![]() |
0.412 | ||
ENC001605 | ![]() |
0.839 | D09ANG | ![]() |
0.407 | ||
ENC001687 | ![]() |
0.839 | D0Z5BC | ![]() |
0.406 | ||
ENC001762 | ![]() |
0.839 | D0Z5SM | ![]() |
0.403 |