|
Name |
Corynebactin
|
| Molecular Formula | C39H42N6O18 | |
| IUPAC Name* |
N-[2-[[(2R,3S,6R,7S,10R,11S)-7,11-bis[[2-[(2,3-dihydroxybenzoyl)amino]acetyl]amino]-2,6,10-trimethyl-4,8,12-trioxo-1,5,9-trioxacyclododec-3-yl]amino]-2-oxoethyl]-2,3-dihydroxybenzamide
|
|
| SMILES |
C[C@@H]1[C@@H](C(=O)O[C@@H]([C@@H](C(=O)O[C@@H]([C@@H](C(=O)O1)NC(=O)CNC(=O)C2=C(C(=CC=C2)O)O)C)NC(=O)CNC(=O)C3=C(C(=CC=C3)O)O)C)NC(=O)CNC(=O)C4=C(C(=CC=C4)O)O
|
|
| InChI |
InChI=1S/C39H42N6O18/c1-16-28(43-25(49)13-40-34(55)19-7-4-10-22(46)31(19)52)37(58)62-18(3)30(45-27(51)15-42-36(57)21-9-6-12-24(48)33(21)54)39(60)63-17(2)29(38(59)61-16)44-26(50)14-41-35(56)20-8-5-11-23(47)32(20)53/h4-12,16-18,28-30,46-48,52-54H,13-15H2,1-3H3,(H,40,55)(H,41,56)(H,42,57)(H,43,49)(H,44,50)(H,45,51)/t16-,17-,18-,28+,29+,30+/m1/s1
|
|
| InChIKey |
RCQTVEFBFUNTGM-BDVHUIKKSA-N
|
|
| Synonyms |
Corynebactin; Bacillibactin; 95536-41-7; 36PG6K45CP; N,N',N''-{[(2R,3S,6R,7S,10R,11S)-2,6,10-trimethyl-4,8,12-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[imino(2-oxoethane-2,1-diyl)]}tris(2,3-dihydroxybenzamide); 9-Gln-beta-lipotropin; beta-Lipotropin, gln(9)-; 9-Glutamine-beta-lipotropin; beta-Lipotropin, glutamine(9)-; UNII-36PG6K45CP; SCHEMBL18913548; CHEBI:31432; DTXSID101045559; 95536-04-2; 2,3-dihydroxybenzoate-glycine-threonine trimeric ester; Q14931586; L-THREONINE, N-(2,3-DIHYDROXYBENZOYL)GLYCYL-, TRIMOL. (2->2'),(2'->2''),(2''->2)-TRILACTONE; N-(2-(((2R,3S,6R,7S,10R,11S)-7,11-BIS((2-((2,3-DIHYDROXYBENZOYL)AMINO)ACETYL)AMINO)-2,6,10-TRIMETHYL-4,8,12-TRIOXO-1,5,9-TRIOXACYCLODODEC-3-YL)AMINO)-2-OXOETHYL)-2,3-DIHYDROXYBENZAMIDE
|
|
| CAS | 95536-41-7 | |
| PubChem CID | 125349 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 882.8 | ALogp: | 1.6 |
| HBD: | 12 | HBA: | 18 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 375.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 63 | QED Weighted: | 0.055 |
| Caco-2 Permeability: | -7.213 | MDCK Permeability: | 0.00000428 |
| Pgp-inhibitor: | 0.549 | Pgp-substrate: | 0.555 |
| Human Intestinal Absorption (HIA): | 0.237 | 20% Bioavailability (F20%): | 0.957 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 91.15% |
| Volume Distribution (VD): | 0.374 | Fu: | 19.25% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.002 |
| CYP2C19-inhibitor: | 0.076 | CYP2C19-substrate: | 0.019 |
| CYP2C9-inhibitor: | 0.432 | CYP2C9-substrate: | 0.274 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.078 |
| CYP3A4-inhibitor: | 0.33 | CYP3A4-substrate: | 0.006 |
| Clearance (CL): | 2.782 | Half-life (T1/2): | 0.958 |
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.057 |
| Drug-inuced Liver Injury (DILI): | 0.196 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0 |
| Skin Sensitization: | 0.035 | Carcinogencity: | 0.005 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.002 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001503 | ![]() |
0.287 | D0P4VX | ![]() |
0.242 | ||
| ENC001023 | ![]() |
0.284 | D0U4YG | ![]() |
0.232 | ||
| ENC001502 | ![]() |
0.279 | D0E2OU | ![]() |
0.229 | ||
| ENC000483 | ![]() |
0.276 | D0X7IT | ![]() |
0.220 | ||
| ENC004290 | ![]() |
0.245 | D07IPB | ![]() |
0.217 | ||
| ENC003353 | ![]() |
0.239 | D05HPI | ![]() |
0.216 | ||
| ENC001968 | ![]() |
0.229 | D04VEJ | ![]() |
0.212 | ||
| ENC001969 | ![]() |
0.229 | D0AZ8C | ![]() |
0.212 | ||
| ENC005075 | ![]() |
0.229 | D0T5XN | ![]() |
0.211 | ||
| ENC004764 | ![]() |
0.229 | D09PZZ | ![]() |
0.211 | ||