![]() |
Name |
Antimycin A2
|
Molecular Formula | C27H38N2O9 | |
IUPAC Name* |
[3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate
|
|
SMILES |
CCCCCCC1C(C(OC(=O)C(C(OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC=O)O)C)OC(=O)CCC
|
|
InChI |
InChI=1S/C27H38N2O9/c1-5-7-8-9-12-19-24(38-21(31)11-6-2)17(4)37-27(35)22(16(3)36-26(19)34)29-25(33)18-13-10-14-20(23(18)32)28-15-30/h10,13-17,19,22,24,32H,5-9,11-12H2,1-4H3,(H,28,30)(H,29,33)
|
|
InChIKey |
LYDAGTPXPZARPR-UHFFFAOYSA-N
|
|
Synonyms |
Antimycin A2; 27220-57-1; [3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate; UNII-ZIK247VR77; EINECS 248-342-1; Antimycin A2, ~90%; ZIK247VR77; 3-(3-Formamidosalicylamido)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl butyrate; FT-0734365; J-016699; 3-(3-formamido-2-hydroxybenzamido)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl butyrate; Butanoic acid, 3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester
|
|
CAS | 27220-57-1 | |
PubChem CID | 3084471 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 534.6 | ALogp: | 4.9 |
HBD: | 3 | HBA: | 9 |
Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 157.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 38 | QED Weighted: | 0.118 |
Caco-2 Permeability: | -4.834 | MDCK Permeability: | 0.00006000 |
Pgp-inhibitor: | 0.865 | Pgp-substrate: | 0.025 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.964 | Plasma Protein Binding (PPB): | 88.16% |
Volume Distribution (VD): | 0.653 | Fu: | 7.56% |
CYP1A2-inhibitor: | 0.122 | CYP1A2-substrate: | 0.116 |
CYP2C19-inhibitor: | 0.452 | CYP2C19-substrate: | 0.101 |
CYP2C9-inhibitor: | 0.729 | CYP2C9-substrate: | 0.95 |
CYP2D6-inhibitor: | 0.189 | CYP2D6-substrate: | 0.227 |
CYP3A4-inhibitor: | 0.923 | CYP3A4-substrate: | 0.155 |
Clearance (CL): | 2.256 | Half-life (T1/2): | 0.495 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.587 |
Drug-inuced Liver Injury (DILI): | 0.916 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.018 |
Skin Sensitization: | 0.056 | Carcinogencity: | 0.142 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.019 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001503 | ![]() |
0.924 | D0T9TJ | ![]() |
0.270 | ||
ENC000483 | ![]() |
0.858 | D07IPB | ![]() |
0.260 | ||
ENC001023 | ![]() |
0.789 | D0K8CI | ![]() |
0.252 | ||
ENC004061 | ![]() |
0.327 | D00OAY | ![]() |
0.245 | ||
ENC000878 | ![]() |
0.279 | D09ANG | ![]() |
0.245 | ||
ENC003631 | ![]() |
0.276 | D0NP1J | ![]() |
0.242 | ||
ENC002055 | ![]() |
0.265 | D03ZJE | ![]() |
0.235 | ||
ENC000669 | ![]() |
0.265 | D06TQZ | ![]() |
0.234 | ||
ENC004179 | ![]() |
0.260 | D01WUA | ![]() |
0.228 | ||
ENC002794 | ![]() |
0.259 | D0ZI4H | ![]() |
0.228 |